The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(ethane-1,2-diyl)bis(7-((3-bromobenzyl)oxy)-2-oxo-2H-chromene-3-carboxamide) ID: ALA4760594
PubChem CID: 162658212
Max Phase: Preclinical
Molecular Formula: C36H26Br2N2O8
Molecular Weight: 774.42
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCNC(=O)c1cc2ccc(OCc3cccc(Br)c3)cc2oc1=O)c1cc2ccc(OCc3cccc(Br)c3)cc2oc1=O
Standard InChI: InChI=1S/C36H26Br2N2O8/c37-25-5-1-3-21(13-25)19-45-27-9-7-23-15-29(35(43)47-31(23)17-27)33(41)39-11-12-40-34(42)30-16-24-8-10-28(18-32(24)48-36(30)44)46-20-22-4-2-6-26(38)14-22/h1-10,13-18H,11-12,19-20H2,(H,39,41)(H,40,42)
Standard InChI Key: OSPJANXZFDIWFE-UHFFFAOYSA-N
Molfile:
RDKit 2D
48 53 0 0 0 0 0 0 0 0999 V2000
31.1055 -18.7169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1044 -19.5365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8124 -19.9454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5221 -19.5360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5192 -18.7133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8106 -18.3081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2254 -18.3021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9346 -18.7080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2304 -19.9435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.9375 -19.5338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6462 -19.9406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.6409 -18.2969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6379 -17.4797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.3501 -18.7029 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.3963 -19.9445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6889 -19.5354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9809 -19.9434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2722 -19.5356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5647 -19.9430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5636 -20.7610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2759 -21.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9806 -20.7603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8575 -19.5335 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
36.0563 -18.2918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7655 -18.6978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4717 -18.2867 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.1809 -18.6927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8871 -18.2816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1838 -19.5099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.8842 -17.4644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5904 -17.0532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.5963 -18.6876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1750 -17.0583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.2968 -17.4582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3025 -18.2765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0129 -18.6789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7181 -18.2642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7084 -17.4428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9975 -17.0441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4111 -17.0257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.1237 -17.4257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8264 -17.0086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5387 -17.4109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2409 -16.9944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2315 -16.1764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5139 -15.7766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8146 -16.1954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.9533 -17.3948 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
4 9 1 0
8 10 1 0
9 10 1 0
10 11 2 0
8 12 1 0
12 13 2 0
12 14 1 0
2 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
19 23 1 0
24 14 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
28 32 2 0
28 30 1 0
30 31 1 0
31 34 1 0
35 32 1 0
30 33 2 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
38 40 1 0
40 41 1 0
41 42 1 0
42 43 2 0
43 44 1 0
44 45 2 0
45 46 1 0
46 47 2 0
47 42 1 0
44 48 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 774.42Molecular Weight (Monoisotopic): 772.0056AlogP: 6.74#Rotatable Bonds: 11Polar Surface Area: 137.08Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.93CX Basic pKa: ┄CX LogP: 6.07CX LogD: 6.07Aromatic Rings: 6Heavy Atoms: 48QED Weighted: 0.11Np Likeness Score: -0.51
References 1. Ji H,Tan Y,Gan N,Zhang J,Li S,Zheng X,Wang Z,Yi W. (2021) Synthesis and anticancer activity of new coumarin-3-carboxylic acid derivatives as potential lactatetransportinhibitors., 29 [PMID:33221062 ] [10.1016/j.bmc.2020.115870 ]