(S,Z)-N-(1-bromo-3-((1-hydroxy-3-phenylpropan-2-yl)amino)-3-oxo-1-phenylprop-1-en-2-yl)-2,4-difluorobenzamide

ID: ALA4760740

PubChem CID: 162658143

Max Phase: Preclinical

Molecular Formula: C25H21BrF2N2O3

Molecular Weight: 515.35

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(N[C@H](CO)Cc1ccccc1)/C(NC(=O)c1ccc(F)cc1F)=C(/Br)c1ccccc1

Standard InChI:  InChI=1S/C25H21BrF2N2O3/c26-22(17-9-5-2-6-10-17)23(30-24(32)20-12-11-18(27)14-21(20)28)25(33)29-19(15-31)13-16-7-3-1-4-8-16/h1-12,14,19,31H,13,15H2,(H,29,33)(H,30,32)/b23-22-/t19-/m0/s1

Standard InChI Key:  LVLXLQYRAXOAAC-ZABCRHKISA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   27.1310   -1.4569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1298   -2.2764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8379   -2.6854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5475   -2.2759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5447   -1.4533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8361   -1.0480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8377   -3.5026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1299   -3.9110    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   28.5453   -3.9113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5451   -4.7285    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.2531   -3.5029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9607   -3.9117    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.2533   -2.6857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.6685   -3.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3761   -3.9120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6687   -2.6861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3765   -2.2776    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.3759   -4.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2527   -5.1373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2525   -5.9545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9605   -4.7289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5457   -6.3607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5451   -7.1771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2532   -7.5867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9634   -7.1739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9605   -6.3588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6685   -5.1334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6680   -5.9498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3761   -6.3594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0863   -5.9466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0833   -5.1315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8385   -5.9511    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   29.2541   -8.4039    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  1  0
  7  9  2  0
  9 10  1  0
  9 11  1  0
 11 12  1  0
 11 13  2  0
 14 12  1  6
 14 15  1  0
 14 16  1  0
 16 17  1  0
 15 18  1  0
 10 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 20  1  0
 18 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 18  1  0
 22 32  1  0
 24 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4760740

    ---

Associated Targets(Human)

HepG2 2.2.15 (869 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Hepatitis B virus (7925 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 515.35Molecular Weight (Monoisotopic): 514.0704AlogP: 4.18#Rotatable Bonds: 8
Polar Surface Area: 78.43Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.86CX Basic pKa: CX LogP: 4.06CX LogD: 4.06
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.39Np Likeness Score: -0.80

References

1. Gu X,Zhang Y,Zou Y,Li X,Guan M,Zhou Q,Qiu J.  (2021)  Synthesis and evaluation of new phenyl acrylamide derivatives as potent non-nucleoside anti-HBV agents.,  29  [PMID:33285406] [10.1016/j.bmc.2020.115892]

Source