The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(4-(2,5-dimethyl-1H-pyrrol-1-yl)phenyl)-2-methyl-1H-benzo[d]imidazole-4-carboxylic acid ID: ALA4760820
PubChem CID: 135313634
Max Phase: Preclinical
Molecular Formula: C21H19N3O2
Molecular Weight: 345.40
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc2c(C(=O)O)cc(-c3ccc(-n4c(C)ccc4C)cc3)cc2[nH]1
Standard InChI: InChI=1S/C21H19N3O2/c1-12-4-5-13(2)24(12)17-8-6-15(7-9-17)16-10-18(21(25)26)20-19(11-16)22-14(3)23-20/h4-11H,1-3H3,(H,22,23)(H,25,26)
Standard InChI Key: FFEWZJDIIOWZHG-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 29 0 0 0 0 0 0 0 0999 V2000
42.4595 -15.3161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4584 -16.1356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1664 -16.5446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1646 -14.9072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8732 -15.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8735 -16.1357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6565 -16.3899 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.1402 -15.7237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6561 -15.0580 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.7522 -16.5440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0446 -16.1331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3370 -16.5404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3359 -17.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0483 -17.7675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7529 -17.3578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.9574 -15.7234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1622 -14.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8687 -13.6794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.4533 -13.6836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.6297 -17.7727 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.8829 -17.4407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3365 -18.0483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7455 -18.7559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5447 -18.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7126 -16.6415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1523 -19.1319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
2 10 1 0
8 16 1 0
4 17 1 0
17 18 1 0
17 19 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 20 1 0
13 20 1 0
21 25 1 0
24 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 345.40Molecular Weight (Monoisotopic): 345.1477AlogP: 4.64#Rotatable Bonds: 3Polar Surface Area: 70.91Molecular Species: ACIDHBA: 3HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 2.07CX Basic pKa: 6.41CX LogP: 2.41CX LogD: 1.43Aromatic Rings: 4Heavy Atoms: 26QED Weighted: 0.57Np Likeness Score: -0.96