N-(4-(4-(2-methoxyethyl)piperazin-1-yl)phenyl)-4-(2-phenyl-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-3-yl)pyrimidin-2-amine

ID: ALA4760836

PubChem CID: 162657936

Max Phase: Preclinical

Molecular Formula: C29H33N7O2

Molecular Weight: 511.63

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COCCN1CCN(c2ccc(Nc3nccc(-c4c(-c5ccccc5)nn5c4COCC5)n3)cc2)CC1

Standard InChI:  InChI=1S/C29H33N7O2/c1-37-19-17-34-13-15-35(16-14-34)24-9-7-23(8-10-24)31-29-30-12-11-25(32-29)27-26-21-38-20-18-36(26)33-28(27)22-5-3-2-4-6-22/h2-12H,13-21H2,1H3,(H,30,31,32)

Standard InChI Key:  UKIRGPFKPDEHGI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
    5.6048  -22.4026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6048  -23.2198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3101  -23.6243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3101  -21.9899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0153  -22.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0198  -23.2163    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7950  -23.4635    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2697  -22.8026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7878  -22.1470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0347  -21.3705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8344  -21.1973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0828  -20.4195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5324  -19.8143    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7304  -19.9921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4858  -20.7696    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0851  -22.7952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4970  -23.5023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3134  -23.4981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7189  -22.7876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3020  -22.0798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4869  -22.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1781  -19.3897    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4236  -18.6103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2221  -18.4346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4677  -17.6559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9152  -17.0527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1139  -17.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8720  -18.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1605  -16.2729    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9594  -16.0964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2047  -15.3206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6545  -14.7159    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8556  -14.8924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6069  -15.6736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9019  -13.9371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7001  -13.7619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9475  -12.9831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7457  -12.8079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  9 10  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  8 16  1  0
 14 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 29 30  1  0
 29 34  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 26 29  1  0
 32 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4760836

    ---

Associated Targets(Human)

ACVR1 Tchem Activin receptor type-1 (1516 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 511.63Molecular Weight (Monoisotopic): 511.2696AlogP: 4.05#Rotatable Bonds: 8
Polar Surface Area: 80.57Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.85CX LogP: 4.19CX LogD: 3.61
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.38Np Likeness Score: -1.52

References

1. Yamamoto H,Sakai N,Ohte S,Sato T,Sekimata K,Matsumoto T,Nakamura K,Watanabe H,Mishima-Tsumagari C,Tanaka A,Hashizume Y,Honma T,Katagiri T,Miyazono K,Tomoda H,Shirouzu M,Koyama H.  (2021)  Novel bicyclic pyrazoles as potent ALK2 (R206H) inhibitors for the treatment of fibrodysplasia ossificans progressiva.,  38  [PMID:33609658] [10.1016/j.bmcl.2021.127858]

Source