The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(4-(2-methoxyethyl)piperazin-1-yl)phenyl)-4-(2-phenyl-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-3-yl)pyrimidin-2-amine ID: ALA4760836
PubChem CID: 162657936
Max Phase: Preclinical
Molecular Formula: C29H33N7O2
Molecular Weight: 511.63
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCN1CCN(c2ccc(Nc3nccc(-c4c(-c5ccccc5)nn5c4COCC5)n3)cc2)CC1
Standard InChI: InChI=1S/C29H33N7O2/c1-37-19-17-34-13-15-35(16-14-34)24-9-7-23(8-10-24)31-29-30-12-11-25(32-29)27-26-21-38-20-18-36(26)33-28(27)22-5-3-2-4-6-22/h2-12H,13-21H2,1H3,(H,30,31,32)
Standard InChI Key: UKIRGPFKPDEHGI-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
5.6048 -22.4026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6048 -23.2198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3101 -23.6243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3101 -21.9899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0153 -22.4026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0198 -23.2163 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7950 -23.4635 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2697 -22.8026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7878 -22.1470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0347 -21.3705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8344 -21.1973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0828 -20.4195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5324 -19.8143 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7304 -19.9921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4858 -20.7696 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0851 -22.7952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4970 -23.5023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3134 -23.4981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7189 -22.7876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3020 -22.0798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4869 -22.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1781 -19.3897 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4236 -18.6103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2221 -18.4346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4677 -17.6559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9152 -17.0527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1139 -17.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8720 -18.0116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1605 -16.2729 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9594 -16.0964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2047 -15.3206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6545 -14.7159 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8556 -14.8924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6069 -15.6736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9019 -13.9371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7001 -13.7619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9475 -12.9831 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7457 -12.8079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 2 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
9 10 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
8 16 1 0
14 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
29 30 1 0
29 34 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
26 29 1 0
32 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 511.63Molecular Weight (Monoisotopic): 511.2696AlogP: 4.05#Rotatable Bonds: 8Polar Surface Area: 80.57Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.85CX LogP: 4.19CX LogD: 3.61Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.38Np Likeness Score: -1.52
References 1. Yamamoto H,Sakai N,Ohte S,Sato T,Sekimata K,Matsumoto T,Nakamura K,Watanabe H,Mishima-Tsumagari C,Tanaka A,Hashizume Y,Honma T,Katagiri T,Miyazono K,Tomoda H,Shirouzu M,Koyama H. (2021) Novel bicyclic pyrazoles as potent ALK2 (R206H) inhibitors for the treatment of fibrodysplasia ossificans progressiva., 38 [PMID:33609658 ] [10.1016/j.bmcl.2021.127858 ]