The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Hydroxy-4-methyl-N-(4-(2-fluoroethoxy)-7-morpholinobenzo[d]thiazol-2-yl)piperidine-1-carboxamide ID: ALA4760845
PubChem CID: 162658052
Max Phase: Preclinical
Molecular Formula: C20H27FN4O4S
Molecular Weight: 438.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC1(O)CCN(C(=O)Nc2nc3c(OCCF)ccc(N4CCOCC4)c3s2)CC1
Standard InChI: InChI=1S/C20H27FN4O4S/c1-20(27)4-7-25(8-5-20)19(26)23-18-22-16-15(29-11-6-21)3-2-14(17(16)30-18)24-9-12-28-13-10-24/h2-3,27H,4-13H2,1H3,(H,22,23,26)
Standard InChI Key: FKAMJDQVNRCUNU-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
24.8407 -15.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8456 -14.4342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1352 -14.8379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1494 -17.6769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1483 -18.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8563 -18.9054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8545 -17.2680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5632 -17.6733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5634 -18.4965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3464 -18.7506 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.8301 -18.0845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3460 -17.4187 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
22.8516 -16.4510 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5592 -16.0404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5583 -15.2269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8511 -14.8171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1432 -15.2269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1425 -16.0465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8542 -19.7212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.6465 -18.0870 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.0572 -17.3805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8744 -17.3830 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.6508 -16.6716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.0612 -15.9607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6583 -15.2539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4278 -15.9535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8324 -16.6665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5609 -20.1316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2697 -19.7248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9763 -20.1352 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 3 1 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 1 0
7 13 1 0
13 14 1 0
13 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
6 19 1 0
11 20 1 0
20 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
23 27 1 0
24 25 1 0
25 1 1 0
1 26 1 0
26 27 1 0
19 28 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.53Molecular Weight (Monoisotopic): 438.1737AlogP: 2.86#Rotatable Bonds: 5Polar Surface Area: 87.16Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.96CX Basic pKa: 0.11CX LogP: 1.68CX LogD: 1.58Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.75Np Likeness Score: -1.49
References 1. Renk DR,Skraban M,Bier D,Schulze A,Wabbals E,Wedekind F,Neumaier F,Neumaier B,Holschbach M. (2021) Design, synthesis and biological evaluation of Tozadenant analogues as adenosine A receptor ligands., 214 [PMID:33548636 ] [10.1016/j.ejmech.2021.113214 ]