NA

ID: ALA4760979

PubChem CID: 162660204

Max Phase: Preclinical

Molecular Formula: C23H27NO5

Molecular Weight: 397.47

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C#CCCNC(=O)[C@H]1[C@H]2[C@@]3(C=C[C@H](O)[C@@]2(C)C(=O)O3)[C@@H]2CC[C@]3(O)C[C@@]21CC3=C

Standard InChI:  InChI=1S/C23H27NO5/c1-4-5-10-24-18(26)16-17-20(3)15(25)7-9-23(17,29-19(20)27)14-6-8-22(28)12-21(14,16)11-13(22)2/h1,7,9,14-17,25,28H,2,5-6,8,10-12H2,3H3,(H,24,26)/t14-,15+,16-,17-,20-,21+,22+,23-/m1/s1

Standard InChI Key:  YAHMHRJVDUWEMN-YUGIPULTSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
    3.7379   -2.3447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7379   -3.1697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4488   -3.5779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4488   -1.9279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1597   -2.3447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1643   -3.1661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9507   -3.4097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4338   -2.7481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9434   -2.0840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1479   -1.2826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2621   -2.7764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9053   -0.9426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7964   -2.1437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6391   -1.3315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6827   -2.8119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2112   -3.6453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4493   -2.7529    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4409   -4.3988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5949   -4.3704    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0284   -3.5774    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2020   -4.1892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6544   -4.8058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0051   -4.3602    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5821   -2.3490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6676   -1.7554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3701   -0.9314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3459   -1.4901    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.2597   -5.1449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0666   -5.3168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3213   -6.1015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5760   -6.8862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  9  5  1  0
  8  9  1  0
  9 10  1  0
  8 11  1  1
 10 12  1  0
 11 13  1  0
 12 14  1  0
 13 14  1  0
  5 15  1  6
  3 16  1  0
 15 16  1  0
  6 17  1  1
  3 18  1  1
 16 19  2  0
  2 20  1  1
  7 21  1  1
 21 22  2  0
 21 23  1  0
 13 24  2  0
  8 25  1  0
 14 25  1  0
 14 26  1  6
  9 27  1  1
 23 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  3  0
M  END

Alternative Forms

  1. Parent:

    ALA4760979

    ---

Associated Targets(Human)

CHUK Tchem Inhibitor of nuclear factor kappa B kinase alpha subunit (3170 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 397.47Molecular Weight (Monoisotopic): 397.1889AlogP: 1.08#Rotatable Bonds: 3
Polar Surface Area: 95.86Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.90CX LogP: 0.28CX LogD: 0.28
Aromatic Rings: Heavy Atoms: 29QED Weighted: 0.29Np Likeness Score: 2.69

References

1. Annand JR,Henderson AR,Cole KS,Maurais AJ,Becerra J,Liu Y,Weerapana E,Koehler AN,Mapp AK,Schindler CS.  (2020)  Gibberellin JRA-003: A Selective Inhibitor of Nuclear Translocation of IKKα.,  11  (10): [PMID:33062173] [10.1021/acsmedchemlett.9b00613]

Source