N-(3-chloro-4-methoxyphenyl)-N-(2-oxo-2-(phenethylamino)-1-(thiophen-2-yl)ethyl)-3-(trimethylsilyl)propiolamide

ID: ALA4760983

PubChem CID: 162660207

Max Phase: Preclinical

Molecular Formula: C27H29ClN2O3SSi

Molecular Weight: 525.15

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(N(C(=O)C#C[Si](C)(C)C)C(C(=O)NCCc2ccccc2)c2cccs2)cc1Cl

Standard InChI:  InChI=1S/C27H29ClN2O3SSi/c1-33-23-13-12-21(19-22(23)28)30(25(31)15-18-35(2,3)4)26(24-11-8-17-34-24)27(32)29-16-14-20-9-6-5-7-10-20/h5-13,17,19,26H,14,16H2,1-4H3,(H,29,32)

Standard InChI Key:  BVTWNCLPYQNFLW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
   18.5575   -4.8492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5564   -5.6771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2680   -6.0880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9854   -5.6766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9826   -4.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2662   -4.4341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2638   -3.6086    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.9780   -3.1958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9755   -2.3704    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.6946   -3.6044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5513   -3.2001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5488   -2.3746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7015   -6.0861    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   19.2678   -6.9135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5564   -7.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8370   -3.6128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8395   -4.4383    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.1203   -3.2043    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4061   -3.6171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6894   -3.2086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9752   -3.6214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2592   -3.2096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5454   -3.6217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5474   -4.4481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2690   -4.8605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9799   -4.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2112   -1.8892    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.9551   -1.1047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1295   -1.1072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8782   -1.8933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4100   -4.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1287   -4.4165    0.0000 Si  0  0  0  0  0  4  0  0  0  0  0  0
   22.8356   -3.9984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1374   -5.2377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8357   -4.8244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
  7 11  1  0
 11 12  1  0
  4 13  1  0
  3 14  1  0
 14 15  1  0
 11 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 12 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 12  2  0
 10 31  3  0
 31 32  1  0
 32 33  1  0
 32 34  1  0
 32 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4760983

    ---

Associated Targets(Human)

GPX4 Tchem Phospholipid hydroperoxide glutathione peroxidase (167 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 525.15Molecular Weight (Monoisotopic): 524.1357AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Eaton JK,Furst L,Cai LL,Viswanathan VS,Schreiber SL.  (2020)  Structure-activity relationships of GPX4 inhibitor warheads.,  30  (23.0): [PMID:32920142] [10.1016/j.bmcl.2020.127538]

Source