The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(4-(3-(5-((5-tert-butyloxazol-2-yl)methylthio)thiazol-2-ylamino)piperidine-1-carbonyl)phenyl)-4-(dimethylamino)but-2-enamide ID: ALA4761001
PubChem CID: 137358236
Max Phase: Preclinical
Molecular Formula: C29H38N6O3S2
Molecular Weight: 582.80
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)C/C=C/C(=O)Nc1ccc(C(=O)N2CCCC(Nc3ncc(SCc4ncc(C(C)(C)C)o4)s3)C2)cc1
Standard InChI: InChI=1S/C29H38N6O3S2/c1-29(2,3)23-16-30-25(38-23)19-39-26-17-31-28(40-26)33-22-8-6-15-35(18-22)27(37)20-10-12-21(13-11-20)32-24(36)9-7-14-34(4)5/h7,9-13,16-17,22H,6,8,14-15,18-19H2,1-5H3,(H,31,33)(H,32,36)/b9-7+
Standard InChI Key: LRXFEHJUJZDISP-VQHVLOKHSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
38.7898 -19.4300 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.4960 -19.0188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2414 -19.3467 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
40.7859 -18.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3746 -18.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5760 -18.2042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.5967 -18.8163 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
41.9305 -19.5633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7433 -19.6476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0806 -19.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0824 -18.2078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3773 -17.8020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.6687 -18.2098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6698 -19.0279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3795 -19.4383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3773 -16.9848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0850 -16.5762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.6696 -16.5762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6715 -15.7592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9646 -15.3506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2559 -15.7593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2586 -16.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9660 -16.9855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5477 -15.3516 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.5466 -14.5344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8384 -14.1267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2538 -14.1249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.8373 -13.3096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1538 -20.3519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.9529 -20.1809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0372 -19.3681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2902 -19.0368 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.5609 -20.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3921 -21.5265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1354 -20.1409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2633 -21.1314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1291 -12.9019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1280 -12.0847 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.4197 -11.6770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8352 -11.6752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 2 2 0
7 8 1 0
4 7 1 0
8 9 1 0
10 1 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
12 16 1 0
16 17 2 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
26 28 2 0
9 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 9 2 0
30 33 1 0
33 34 1 0
33 35 1 0
33 36 1 0
28 37 1 0
37 38 1 0
38 39 1 0
38 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 582.80Molecular Weight (Monoisotopic): 582.2447AlogP: 5.49#Rotatable Bonds: 10Polar Surface Area: 103.60Molecular Species: BASEHBA: 9HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.91CX Basic pKa: 8.81CX LogP: 3.85CX LogD: 2.43Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.24Np Likeness Score: -1.54
References 1. (2020) Inhibitors of cyclin-dependent kinases,