The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-[2-[1-[3-(3,4-dichlorophenyl)propanoyl]azetidin-3-yl]oxyphenyl]-N-(3-pyrrolidin-1-ylpropyl)pyridine-3-carboxamide ID: ALA4761059
PubChem CID: 162660723
Max Phase: Preclinical
Molecular Formula: C31H34Cl2N4O3
Molecular Weight: 581.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCCN1CCCC1)c1cncc(-c2ccccc2OC2CN(C(=O)CCc3ccc(Cl)c(Cl)c3)C2)c1
Standard InChI: InChI=1S/C31H34Cl2N4O3/c32-27-10-8-22(16-28(27)33)9-11-30(38)37-20-25(21-37)40-29-7-2-1-6-26(29)23-17-24(19-34-18-23)31(39)35-12-5-15-36-13-3-4-14-36/h1-2,6-8,10,16-19,25H,3-5,9,11-15,20-21H2,(H,35,39)
Standard InChI Key: LQUSONOPQWQVOC-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
2.6606 -12.7985 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6595 -13.6222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3675 -14.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0813 -13.6217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0785 -12.7949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3658 -12.3855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7888 -12.3795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5022 -12.7896 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7857 -11.5582 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2125 -12.3742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9258 -12.7842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6361 -12.3688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3495 -12.7789 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4345 -13.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2386 -13.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6446 -13.0491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0913 -12.4440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3667 -14.8435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6567 -15.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6551 -16.0668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3628 -16.4773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0734 -16.0654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0715 -15.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7787 -14.8408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4869 -15.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7011 -16.0342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4902 -15.8217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2777 -15.0327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1984 -16.2295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1994 -17.0466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9056 -15.8200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6138 -16.2277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3210 -15.8182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0256 -16.2290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7323 -15.8202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7317 -15.0021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0185 -14.5946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3147 -15.0057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4403 -16.2282 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.4384 -14.5917 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
3 18 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 25 1 0
27 29 1 0
29 30 2 0
29 31 1 0
31 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
35 39 1 0
36 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 581.54Molecular Weight (Monoisotopic): 580.2008AlogP: 5.49#Rotatable Bonds: 11Polar Surface Area: 74.77Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.97CX Basic pKa: 9.28CX LogP: 4.42CX LogD: 2.55Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.30Np Likeness Score: -1.19
References 1. Zhang B,Liao L,Wu F,Zhang F,Sun Z,Chen H,Luo C. (2020) Synthesis and structure-activity relationship studies of LLY-507 analogues as SMYD2 inhibitors., 30 (22): [PMID:33011288 ] [10.1016/j.bmcl.2020.127598 ]