The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(Diethylamino)-2-oxo-N'-[1-(pyridin-3-yl)ethylidene]-2H-chromene-3-carbohydrazide ID: ALA4761109
PubChem CID: 162659675
Max Phase: Preclinical
Molecular Formula: C21H22N4O3
Molecular Weight: 378.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)c1ccc2cc(C(=O)N/N=C(/C)c3cccnc3)c(=O)oc2c1
Standard InChI: InChI=1S/C21H22N4O3/c1-4-25(5-2)17-9-8-15-11-18(21(27)28-19(15)12-17)20(26)24-23-14(3)16-7-6-10-22-13-16/h6-13H,4-5H2,1-3H3,(H,24,26)/b23-14-
Standard InChI Key: XGCQKURVCVFTNJ-UCQKPKSFSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
40.1483 -18.5766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1471 -19.3962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8552 -19.8051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5648 -19.3957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5620 -18.5730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8534 -18.1678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2682 -18.1618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9774 -18.5677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2732 -19.8032 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.9802 -19.3935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6890 -19.8003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.6836 -18.1565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6807 -17.3394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.3928 -18.5626 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.4391 -19.8042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.7317 -19.3950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4384 -20.6214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7304 -21.0294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0237 -19.8031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.0990 -18.1514 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.8082 -18.5575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.5144 -18.1463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.8123 -19.3736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1044 -19.7842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1070 -20.6006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.8167 -21.0075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.5253 -20.5919 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
46.5192 -19.7769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
4 9 1 0
8 10 1 0
9 10 1 0
10 11 2 0
8 12 1 0
12 13 2 0
12 14 1 0
2 15 1 0
15 16 1 0
15 17 1 0
17 18 1 0
16 19 1 0
14 20 1 0
20 21 2 0
21 22 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
21 23 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 378.43Molecular Weight (Monoisotopic): 378.1692AlogP: 3.19#Rotatable Bonds: 6Polar Surface Area: 87.80Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.58CX Basic pKa: 4.55CX LogP: 2.15CX LogD: 2.15Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.40Np Likeness Score: -1.43
References 1. Ji H,Tan Y,Gan N,Zhang J,Li S,Zheng X,Wang Z,Yi W. (2021) Synthesis and anticancer activity of new coumarin-3-carboxylic acid derivatives as potential lactatetransportinhibitors., 29 [PMID:33221062 ] [10.1016/j.bmc.2020.115870 ]