(R)-N-((R)-1-(((S)-1-amino-3-methyl-1-oxobutan-2-yl)(methyl)amino)-3-(4-methoxyphenyl)-1-oxopropan-2-yl)-N,2-dimethyl-3-oxooctanamide

ID: ALA4761182

PubChem CID: 162659022

Max Phase: Preclinical

Molecular Formula: C26H41N3O5

Molecular Weight: 475.63

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  CCCCCC(=O)[C@@H](C)C(=O)N(C)[C@H](Cc1ccc(OC)cc1)C(=O)N(C)[C@H](C(N)=O)C(C)C

Standard InChI:  InChI=1S/C26H41N3O5/c1-8-9-10-11-22(30)18(4)25(32)28(5)21(16-19-12-14-20(34-7)15-13-19)26(33)29(6)23(17(2)3)24(27)31/h12-15,17-18,21,23H,8-11,16H2,1-7H3,(H2,27,31)/t18-,21-,23+/m1/s1

Standard InChI Key:  MFTPPNDBMOBBQO-AAIMPIBUSA-N

Molfile:  

 
     RDKit          2D

 34 34  0  0  0  0  0  0  0  0999 V2000
   21.9472  -20.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9460  -21.7528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6541  -22.1618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3637  -21.7523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3609  -20.9297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6523  -20.5244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2380  -22.1608    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5306  -21.7517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0671  -20.5184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7763  -20.9243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4825  -20.5131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7794  -21.7415    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0732  -22.1528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4886  -22.1474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4917  -22.9646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1948  -21.7362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.7856  -23.3759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0763  -22.9700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1917  -20.9190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.4794  -19.6959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.1856  -19.2846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7702  -19.2900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8948  -19.6906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6010  -19.2793    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.8979  -20.5077    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1825  -18.4674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8887  -18.0562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4732  -18.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2010  -23.3706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7886  -24.1931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3702  -23.3812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6609  -22.9753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9547  -23.3866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2455  -22.9806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  1  0
  5  9  1  0
 10  9  1  6
 10 11  1  0
 10 12  1  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  1  0
 11 19  2  0
 11 20  1  0
 20 21  1  0
 20 22  1  0
 21 23  1  0
 23 24  1  0
 23 25  2  0
 21 26  1  1
 26 27  1  0
 26 28  1  0
 15 29  1  6
 17 30  2  0
 18 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4761182

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 475.63

Molecular Weight (Monoisotopic): 475.3046

AlogP: 2.82

#Rotatable Bonds: 14

Polar Surface Area: 110.01

Molecular Species: NEUTRAL

HBA: 5

HBD: 1

#RO5 Violations: ┄

HBA (Lipinski): 8

HBD (Lipinski): 2

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 11.79

CX Basic pKa: ┄

CX LogP: 3.53

CX LogD: 3.53

Aromatic Rings: 1

Heavy Atoms: 34

QED Weighted: 0.33

Np Likeness Score: 0.41

References

1. Natsume N,Ozaki K,Nakajima D,Yokoshima S,Teruya T.  (2020)  Structure-Activity Relationship Study of Majusculamides A and B and Their Analogues on Osteogenic Activity.,  83  (8.0): [PMID:32786886] [10.1021/acs.jnatprod.0c00441]

Source

Source(1):

• Scientific Literature