The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-5-amino-5-oxo-4-(4-(4-phenylthiophen-2-yl)benzamido)pentanoic acid ID: ALA4761188
PubChem CID: 57336496
Max Phase: Preclinical
Molecular Formula: C22H20N2O4S
Molecular Weight: 408.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)[C@H](CCC(=O)O)NC(=O)c1ccc(-c2cc(-c3ccccc3)cs2)cc1
Standard InChI: InChI=1S/C22H20N2O4S/c23-21(27)18(10-11-20(25)26)24-22(28)16-8-6-15(7-9-16)19-12-17(13-29-19)14-4-2-1-3-5-14/h1-9,12-13,18H,10-11H2,(H2,23,27)(H,24,28)(H,25,26)/t18-/m0/s1
Standard InChI Key: ADDJDJQFPKUMAF-SFHVURJKSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
6.3691 -9.9953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3680 -10.8226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0827 -11.2355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7992 -10.8221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7962 -9.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0809 -9.5826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6517 -11.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8983 -10.8999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3458 -11.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7578 -12.2274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5648 -12.0563 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.5278 -11.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1937 -10.6705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3742 -10.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8878 -11.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2269 -12.0075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0455 -12.0910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5091 -9.5765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2252 -9.9864 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5060 -8.7515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9380 -9.5711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6540 -9.9809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9349 -8.7462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6478 -8.3310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6447 -7.5061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3576 -7.0909 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9287 -7.0962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6571 -10.8059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3669 -9.5658 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 7 1 0
2 7 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
9 12 1 0
5 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
21 22 1 0
21 23 1 1
23 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
22 28 2 0
22 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 408.48Molecular Weight (Monoisotopic): 408.1144AlogP: 3.53#Rotatable Bonds: 8Polar Surface Area: 109.49Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.08CX Basic pKa: ┄CX LogP: 3.01CX LogD: -0.11Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.53Np Likeness Score: -0.49
References 1. Zipfel P,Rochais C,Baranger K,Rivera S,Dallemagne P. (2020) Matrix Metalloproteinases as New Targets in Alzheimer's Disease: Opportunities and Challenges., 63 (19.0): [PMID:32459966 ] [10.1021/acs.jmedchem.0c00352 ]