The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-(2,5-dimethoxybenzylidene)hydrazineyl)-4-(4-(methylsulfonyl)phenyl)thiazole ID: ALA4761194
PubChem CID: 162659028
Max Phase: Preclinical
Molecular Formula: C19H19N3O4S2
Molecular Weight: 417.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(OC)c(/C=N/Nc2nc(-c3ccc(S(C)(=O)=O)cc3)cs2)c1
Standard InChI: InChI=1S/C19H19N3O4S2/c1-25-15-6-9-18(26-2)14(10-15)11-20-22-19-21-17(12-27-19)13-4-7-16(8-5-13)28(3,23)24/h4-12H,1-3H3,(H,21,22)/b20-11+
Standard InChI Key: LRNJNXWJQXEBKI-RGVLZGJSSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
8.1678 -20.1945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9573 -20.9870 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.7488 -20.7730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2945 -17.3797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2934 -18.1993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0014 -18.6082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7111 -18.1988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7083 -17.3761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9996 -16.9709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0012 -19.4254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7088 -19.8342 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7086 -20.6514 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4162 -21.0601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5044 -21.8692 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.3037 -22.0393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7125 -21.3316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1658 -20.7243 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5229 -21.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0027 -21.9065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8147 -21.8217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1480 -21.0746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6632 -20.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8529 -20.4997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4417 -21.6488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4194 -18.6063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4207 -19.4235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5867 -16.9713 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5865 -16.1541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
6 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 13 2 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
16 18 1 0
21 2 1 0
2 24 1 0
7 25 1 0
25 26 1 0
4 27 1 0
27 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 417.51Molecular Weight (Monoisotopic): 417.0817AlogP: 3.68#Rotatable Bonds: 7Polar Surface Area: 89.88Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.06CX Basic pKa: 4.23CX LogP: 3.70CX LogD: 3.70Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.47Np Likeness Score: -1.85
References 1. Sağlık BN,Osmaniye D,Levent S,Çevik UA,Çavuşoğlu BK,Özkay Y,Kaplancıklı ZA. (2021) Design, synthesis and biological assessment of new selective COX-2 inhibitors including methyl sulfonyl moiety., 209 [PMID:33071054 ] [10.1016/j.ejmech.2020.112918 ]