The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-2-[(4,5alpha-Epoxy-3-hydroxy-14beta-methoxy-17-methylmorphinan-6beta-yl)-amino]pentanedioic Acid ID: ALA4761211
PubChem CID: 69121986
Max Phase: Preclinical
Molecular Formula: C23H30N2O7
Molecular Weight: 446.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@@]12CC[C@H](N[C@@H](CCC(=O)O)C(=O)O)[C@@H]3Oc4c(O)ccc5c4[C@@]31CCN(C)[C@@H]2C5
Standard InChI: InChI=1S/C23H30N2O7/c1-25-10-9-22-18-12-3-5-15(26)19(18)32-20(22)13(7-8-23(22,31-2)16(25)11-12)24-14(21(29)30)4-6-17(27)28/h3,5,13-14,16,20,24,26H,4,6-11H2,1-2H3,(H,27,28)(H,29,30)/t13-,14-,16+,20-,22-,23+/m0/s1
Standard InChI Key: IKXIQVMSQGSVLL-GYQVKVEVSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
4.7628 -4.2758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1755 -3.5783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9539 -4.2634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1632 -4.9774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5577 -4.9609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3584 -5.4521 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7752 -2.8684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5618 -3.5659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9786 -2.8684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7752 -2.0595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2428 -3.4916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9886 -3.5783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9638 -4.9898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7570 -4.9609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2428 -2.5506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7611 -3.5535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3766 -4.2882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5800 -2.8767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3642 -5.6873 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3443 -4.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3443 -5.6584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1755 -1.3537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5676 -5.6873 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.3860 -2.5135 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.3972 -2.8761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1814 -5.6894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5882 -6.3981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5918 -4.9827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4090 -4.9848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4054 -6.4002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1778 -7.1048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8194 -4.2781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6371 -4.2775 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4131 -3.5667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 1 1 0
5 3 1 0
6 4 1 0
7 2 1 0
8 3 2 0
9 8 1 0
10 15 1 0
1 11 1 1
12 2 1 0
13 4 1 0
14 5 2 0
15 11 1 0
16 8 1 0
17 13 1 0
2 18 1 1
13 19 1 6
20 16 2 0
21 14 1 0
22 10 1 0
4 23 1 1
7 24 1 6
5 6 1 0
7 10 1 0
12 17 1 0
7 9 1 0
20 14 1 0
18 25 1 0
19 26 1 0
26 27 1 0
26 28 1 1
28 29 1 0
27 30 2 0
27 31 1 0
29 32 1 0
32 33 1 0
32 34 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.50Molecular Weight (Monoisotopic): 446.2053AlogP: 1.11#Rotatable Bonds: 7Polar Surface Area: 128.56Molecular Species: ZWITTERIONHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 1.19CX Basic pKa: 10.77CX LogP: -4.06CX LogD: -4.10Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.49Np Likeness Score: 1.60
References 1. Spetea M,Rief SB,Haddou TB,Fink M,Kristeva E,Mittendorfer H,Haas S,Hummer N,Follia V,Guerrieri E,Asim MF,Sturm S,Schmidhammer H. (2019) Synthesis, Biological, and Structural Explorations of New Zwitterionic Derivatives of 14- O-Methyloxymorphone, as Potent μ/δ Opioid Agonists and Peripherally Selective Antinociceptives., 62 (2): [PMID:30571123 ] [10.1021/acs.jmedchem.8b01327 ]