5-(3-Adamantan-1-ylmethyl-3H-[1,2,3]triazol-4-yl)-thiophene-2-carboxylic acid hydroxyamide

ID: ALA4761368

PubChem CID: 136078547

Max Phase: Preclinical

Molecular Formula: C18H22N4O2S

Molecular Weight: 358.47

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NO)c1ccc(-c2cnnn2CC23CC4CC(CC(C4)C2)C3)s1

Standard InChI:  InChI=1S/C18H22N4O2S/c23-17(20-24)16-2-1-15(25-16)14-9-19-21-22(14)10-18-6-11-3-12(7-18)5-13(4-11)8-18/h1-2,9,11-13,24H,3-8,10H2,(H,20,23)

Standard InChI Key:  LCSRJYOXQLYCTD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 29  0  0  0  0  0  0  0  0999 V2000
   10.2197  -14.6583    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.5499  -14.1711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8072  -13.3873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6322  -13.3873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8895  -14.1711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6870  -14.3858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3271  -13.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0193  -14.3148    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8047  -15.1116    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9816  -15.1568    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5690  -15.8734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9816  -16.5859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6216  -17.0288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8996  -17.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8516  -17.7786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1377  -17.3166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8673  -16.5360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4946  -17.8877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6207  -17.9070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2992  -18.2845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3512  -17.1314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7526  -14.3858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5379  -15.1832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1698  -13.8030    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3724  -14.0136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  6  5  1  0
  7  6  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  6  1  0
 10 11  1  0
 12 11  1  0
 13 12  1  0
 14 13  1  0
 15 14  1  0
 15 16  1  0
 16 17  1  0
 17 12  1  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 14 20  1  0
 21 19  1  0
 12 21  1  0
  2 22  1  0
 22 23  2  0
 22 24  1  0
 24 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4761368

    ---

Associated Targets(Human)

HDAC8 Tclin Histone deacetylase 8 (4516 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 358.47Molecular Weight (Monoisotopic): 358.1463AlogP: 3.34#Rotatable Bonds: 4
Polar Surface Area: 80.04Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.44CX Basic pKa: 0.12CX LogP: 2.77CX LogD: 2.73
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.65Np Likeness Score: -0.91

References

1. Bancet A,Raingeval C,Lomberget T,Le Borgne M,Guichou JF,Krimm I.  (2020)  Fragment Linking Strategies for Structure-Based Drug Design.,  63  (20.0): [PMID:32539387] [10.1021/acs.jmedchem.0c00242]

Source