The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-cyclohexyl-3-[4-[2-[(4-oxo-3H-phthalazin-1-yl)amino]ethyl]phenyl]urea ID: ALA4761521
PubChem CID: 162514666
Max Phase: Preclinical
Molecular Formula: C23H27N5O2
Molecular Weight: 405.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(CCNc2n[nH]c(=O)c3ccccc23)cc1)NC1CCCCC1
Standard InChI: InChI=1S/C23H27N5O2/c29-22-20-9-5-4-8-19(20)21(27-28-22)24-15-14-16-10-12-18(13-11-16)26-23(30)25-17-6-2-1-3-7-17/h4-5,8-13,17H,1-3,6-7,14-15H2,(H,24,27)(H,28,29)(H2,25,26,30)
Standard InChI Key: UJSBBPJVNSFMNR-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
19.0343 -13.8469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7437 -13.4424 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7437 -12.6211 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0343 -12.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0343 -14.6682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0343 -11.3829 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7461 -10.9743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3290 -13.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3316 -12.6229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6243 -12.2127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9139 -12.6209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9154 -13.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6232 -13.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4528 -11.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1615 -10.9779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8641 -11.3904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5723 -10.9843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5748 -10.1662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8632 -9.7560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1578 -10.1645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2830 -9.7585 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.9902 -10.1679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6984 -9.7602 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.9893 -10.9851 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.4056 -10.1696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3999 -10.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1031 -11.3969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8137 -10.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8166 -10.1745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1089 -9.7607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9 4 1 0
8 1 1 0
1 2 1 0
2 3 1 0
3 4 2 0
1 5 2 0
4 6 1 0
6 7 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
7 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
21 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 405.50Molecular Weight (Monoisotopic): 405.2165AlogP: 4.03#Rotatable Bonds: 6Polar Surface Area: 98.91Molecular Species: NEUTRALHBA: 4HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.87CX Basic pKa: 3.69CX LogP: 3.40CX LogD: 3.40Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.50Np Likeness Score: -1.41
References 1. Zhang XJ,Xu Y,Mou HX,Wang S,Hao SY,Chen SW. (2020) The synthesis and anti-tumour properties of novel 4-substituted phthalazinones as Aurora B kinase inhibitors., 30 (23.0): [PMID:32941989 ] [10.1016/j.bmcl.2020.127556 ]