The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl (5S,aR)-9,10,11-trimethoxy-5-(2-((3-methylbut-2-enoyl)oxy)acetamido)-6,7-dihydro-5H-dibenzo[a,c]cyclohepten-3-carboxylate ID: ALA4761555
PubChem CID: 162659260
Max Phase: Preclinical
Molecular Formula: C27H31NO8
Molecular Weight: 497.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccc2c(c1)[C@@H](NC(=O)COC(=O)C=C(C)C)CCc1cc(OC)c(OC)c(OC)c1-2
Standard InChI: InChI=1S/C27H31NO8/c1-15(2)11-23(30)36-14-22(29)28-20-10-8-16-13-21(32-3)25(33-4)26(34-5)24(16)18-9-7-17(12-19(18)20)27(31)35-6/h7,9,11-13,20H,8,10,14H2,1-6H3,(H,28,29)/t20-/m0/s1
Standard InChI Key: SXIMZQRZBHPFCX-FQEVSTJZSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
28.5673 -15.1139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5661 -15.9334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2742 -16.3465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2724 -14.7091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9844 -15.9326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9851 -15.1103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6312 -14.5965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4364 -14.7709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7895 -15.5186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6067 -15.5168 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.0179 -14.8041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8351 -14.8023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6036 -14.0973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2750 -17.1637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.8581 -16.3456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.8595 -14.7096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.8593 -13.8924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1507 -15.9323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5677 -17.5689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4388 -16.2657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6348 -16.4428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3856 -17.2268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9436 -17.8343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7498 -17.6525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9911 -16.8688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3090 -18.2523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0631 -19.0370 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.1101 -18.0714 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.2620 -19.2178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2421 -14.0896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.0634 -14.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4746 -13.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4777 -14.7987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.2959 -13.3732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7030 -12.6646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7061 -14.0800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 5 2 0
6 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
5 21 1 0
7 8 1 0
8 9 1 0
20 9 1 0
9 10 1 6
10 11 1 0
11 12 1 0
11 13 2 0
3 14 1 0
2 15 1 0
1 16 1 0
16 17 1 0
15 18 1 0
14 19 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
24 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
12 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
32 34 2 0
34 35 1 0
34 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.54Molecular Weight (Monoisotopic): 497.2050AlogP: 3.78#Rotatable Bonds: 8Polar Surface Area: 109.39Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.90CX Basic pKa: ┄CX LogP: 3.88CX LogD: 3.88Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.43Np Likeness Score: 0.36
References 1. Sazanova, Ekaterina S., Gracheva, Iuliia A., Allegro, Diane, Barbier, Pascale, Combes, Sebastien, Svirshchevskaya, Elena V., Fedorov, Alexey Yu. (2020) Allocolchicinoids bearing a Michael acceptor fragment for possible irreversible binding of tubulin, 11 (6): [PMID:33479669 ] [10.1039/d0md00060d ]