(4-(bis(4-chlorophenyl)methyl)piperazin-1-yl)(3-bromo-4,5-dihydroisoxazol-5-yl)methanone

ID: ALA4761568

PubChem CID: 162659426

Max Phase: Preclinical

Molecular Formula: C21H20BrCl2N3O2

Molecular Weight: 497.22

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(C1CC(Br)=NO1)N1CCN(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1

Standard InChI:  InChI=1S/C21H20BrCl2N3O2/c22-19-13-18(29-25-19)21(28)27-11-9-26(10-12-27)20(14-1-5-16(23)6-2-14)15-3-7-17(24)8-4-15/h1-8,18,20H,9-13H2

Standard InChI Key:  NUCJSENGDUANOF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    5.3474  -25.9745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9329  -25.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9329  -26.6896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3493  -24.5470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9354  -23.8325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1096  -23.8321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6994  -24.5520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1115  -25.2635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1089  -26.6868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6985  -27.4009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1090  -28.1168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9381  -28.1142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3489  -27.3995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6983  -23.1177    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.6995  -28.8282    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    6.1723  -25.9745    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5827  -26.6896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5827  -25.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4077  -25.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8222  -25.9745    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6471  -25.9745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4077  -26.6895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0575  -25.2596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0575  -26.6895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7224  -27.4425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3335  -27.9958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0485  -27.5854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8791  -26.7787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7975  -27.9210    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  2  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  2  1  0
  3  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  3  1  0
  6 14  1  0
 11 15  1  0
  1 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 17 22  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 21 23  2  0
 21 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 24  1  0
 27 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4761568

    ---

Associated Targets(Human)

GPX4 Tchem Phospholipid hydroperoxide glutathione peroxidase (167 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 497.22Molecular Weight (Monoisotopic): 495.0116AlogP: 4.72#Rotatable Bonds: 4
Polar Surface Area: 45.14Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.47CX LogP: 4.68CX LogD: 4.67
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.61Np Likeness Score: -1.14

References

1. Eaton JK,Furst L,Cai LL,Viswanathan VS,Schreiber SL.  (2020)  Structure-activity relationships of GPX4 inhibitor warheads.,  30  (23.0): [PMID:32920142] [10.1016/j.bmcl.2020.127538]

Source