The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2-((benzo[d][1,3]dioxol-5-ylmethyl)amino)-2-oxoethyl)-N-(4-(tert-butyl)phenyl)-1H-1,2,4-triazole-3-carboxamide ID: ALA4761584
PubChem CID: 162659621
Max Phase: Preclinical
Molecular Formula: C23H25N5O4
Molecular Weight: 435.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)c1ccc(NC(=O)c2ncn(CC(=O)NCc3ccc4c(c3)OCO4)n2)cc1
Standard InChI: InChI=1S/C23H25N5O4/c1-23(2,3)16-5-7-17(8-6-16)26-22(30)21-25-13-28(27-21)12-20(29)24-11-15-4-9-18-19(10-15)32-14-31-18/h4-10,13H,11-12,14H2,1-3H3,(H,24,29)(H,26,30)
Standard InChI Key: TUWMXWLMGCVMOJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
26.8600 -9.9012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2727 -9.1955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4552 -9.1909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9597 -11.5521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6823 -11.9387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3763 -11.5062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9306 -10.7376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6216 -10.3029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3502 -10.6859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9397 -10.1112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.5753 -9.3730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7607 -9.4916 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2663 -11.9846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5451 -11.6003 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.8517 -12.0328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8795 -12.8495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.2837 -11.4445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4906 -11.6414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.8679 -11.1120 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.1744 -11.5443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3712 -12.3374 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1864 -12.3952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4170 -11.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3042 -10.4279 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.5468 -10.1210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4368 -9.3076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6803 -9.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0348 -9.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1533 -10.3158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9075 -10.6197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7725 -11.7397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.1615 -8.3894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 8 1 0
4 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 18 1 0
20 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
23 31 2 0
17 15 1 0
28 2 1 0
2 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 435.48Molecular Weight (Monoisotopic): 435.1907AlogP: 2.87#Rotatable Bonds: 6Polar Surface Area: 107.37Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.22CX Basic pKa: ┄CX LogP: 3.37CX LogD: 3.37Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.62Np Likeness Score: -1.65
References 1. Gibbons GS,Chakraborty A,Grigsby SM,Umeano AC,Liao C,Moukha-Chafiq O,Pathak V,Mathew B,Lee YT,Dou Y,Schürer SC,Reynolds RC,Snowden TS,Nikolovska-Coleska Z. (2020) Identification of DOT1L inhibitors by structure-based virtual screening adapted from a nucleoside-focused library., 189 [PMID:31978781 ] [10.1016/j.ejmech.2019.112023 ]