5-(6-((4-(methylsulfonyl)piperazin-1-yl)methyl)-4-morpholinopyrrolo[1,2-f][1,2,4]triazin-2-yl)-4-(trifluoromethyl)pyridin-2-amine

ID: ALA4761702

PubChem CID: 72549554

Max Phase: Preclinical

Molecular Formula: C22H27F3N8O3S

Molecular Weight: 540.57

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CS(=O)(=O)N1CCN(Cc2cc3c(N4CCOCC4)nc(-c4cnc(N)cc4C(F)(F)F)nn3c2)CC1

Standard InChI:  InChI=1S/C22H27F3N8O3S/c1-37(34,35)32-4-2-30(3-5-32)13-15-10-18-21(31-6-8-36-9-7-31)28-20(29-33(18)14-15)16-12-27-19(26)11-17(16)22(23,24)25/h10-12,14H,2-9,13H2,1H3,(H2,26,27)

Standard InChI Key:  UFAGCJATMFYIDR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   32.8038  -16.8200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3933  -16.1163    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   31.9856  -16.8245    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.2607  -20.0522    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   25.5521  -19.6434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.5490  -20.4606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.6896  -18.0401    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3949  -17.6356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3949  -16.8185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.6896  -16.4057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9843  -17.6356    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.9844  -16.8139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2029  -16.5599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7198  -17.2247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2028  -17.8895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6887  -15.5852    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.4054  -15.1762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4065  -14.3593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6973  -13.9459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.9853  -14.3557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9825  -15.1789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1002  -18.0442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0976  -18.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8039  -19.2720    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.5132  -18.8644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5118  -18.0430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8049  -17.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2192  -19.2764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.9026  -17.2247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4940  -17.9324    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.6754  -17.9322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2669  -18.6359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6720  -19.3460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.4902  -19.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9032  -18.6398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6667  -20.7614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5110  -16.4105    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  0
  5  4  2  0
  4  6  2  0
 12 10  1  0
 11  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 11  1  0
 10 16  1  0
 16 17  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
  8 22  1  0
 25 28  1  0
 14 29  1  0
 29 30  1  0
 30 31  1  0
 30 35  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 33  4  1  0
  4 36  1  0
 27  1  1  0
  1 37  1  0
M  END

Associated Targets(Human)

SJRH30 (203 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PIK3CA Tclin PI3-kinase p110-alpha subunit (12269 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 540.57Molecular Weight (Monoisotopic): 540.1879AlogP: 1.31#Rotatable Bonds: 5
Polar Surface Area: 122.19Molecular Species: NEUTRALHBA: 10HBD: 1
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 5.71CX LogP: 2.01CX LogD: 2.00
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.51Np Likeness Score: -1.60

References

1. Xiang HY,Wang X,Chen YH,Zhang X,Tan C,Wang Y,Su Y,Gao ZW,Chen XY,Xiong B,Gao ZB,Chen Y,Ding J,Meng LH,Yang CH.  (2021)  Identification of methyl (5-(6-((4-(methylsulfonyl)piperazin-1-yl)methyl)-4-morpholinopyrrolo[2,1-f][1,2,4]triazin-2-yl)-4-(trifluoromethyl)pyridin-2-yl)carbamate (CYH33) as an orally bioavailable, highly potent, PI3K alpha inhibitor for the treatment of advanced solid tumors.,  209  [PMID:33109399] [10.1016/j.ejmech.2020.112913]

Source