The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-[1-[4-(3-methylindol-1-yl)butyl]triazol-4-yl]-N-(3-pyrrolidin-1-ylpropyl)benzamide ID: ALA4761722
PubChem CID: 162659432
Max Phase: Preclinical
Molecular Formula: C29H36N6O
Molecular Weight: 484.65
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cn(CCCCn2cc(-c3cccc(C(=O)NCCCN4CCCC4)c3)nn2)c2ccccc12
Standard InChI: InChI=1S/C29H36N6O/c1-23-21-34(28-13-3-2-12-26(23)28)18-6-7-19-35-22-27(31-32-35)24-10-8-11-25(20-24)29(36)30-14-9-17-33-15-4-5-16-33/h2-3,8,10-13,20-22H,4-7,9,14-19H2,1H3,(H,30,36)
Standard InChI Key: DAHJAYUIGZRKJP-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
13.6886 -3.3017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6875 -4.1254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3955 -4.5344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1093 -4.1249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1065 -3.2981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3937 -2.8888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8168 -2.8828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5301 -3.2928 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8137 -2.0614 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2404 -2.8774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9538 -3.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6641 -2.8721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3774 -3.2821 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4625 -4.0989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2666 -4.2658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6725 -3.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1192 -2.9472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3957 -5.3485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7339 -5.8279 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9852 -6.6055 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8025 -6.6067 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0561 -5.8299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5060 -7.0122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2134 -6.6030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9214 -7.0111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6288 -6.6020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3368 -7.0101 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4246 -7.8184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2241 -7.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0849 -6.6729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6304 -7.2799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4268 -7.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6788 -6.3344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1283 -5.7277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3339 -5.9003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5577 -8.7337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 18 2 0
3 18 1 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 31 1 0
30 27 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
29 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.65Molecular Weight (Monoisotopic): 484.2951AlogP: 4.90#Rotatable Bonds: 11Polar Surface Area: 67.98Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.31CX LogP: 4.83CX LogD: 2.93Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.31Np Likeness Score: -1.81
References 1. Zhang B,Liao L,Wu F,Zhang F,Sun Z,Chen H,Luo C. (2020) Synthesis and structure-activity relationship studies of LLY-507 analogues as SMYD2 inhibitors., 30 (22): [PMID:33011288 ] [10.1016/j.bmcl.2020.127598 ]