The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(4-methoxybenzylidene)-2-oxoindolin-5-yl)-3-morpholinopropanamide ID: ALA4761779
PubChem CID: 162660113
Max Phase: Preclinical
Molecular Formula: C23H25N3O4
Molecular Weight: 407.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C2/C(=O)Nc3ccc(NC(=O)CCN4CCOCC4)cc32)cc1
Standard InChI: InChI=1S/C23H25N3O4/c1-29-18-5-2-16(3-6-18)14-20-19-15-17(4-7-21(19)25-23(20)28)24-22(27)8-9-26-10-12-30-13-11-26/h2-7,14-15H,8-13H2,1H3,(H,24,27)(H,25,28)/b20-14+
Standard InChI Key: LMQBXZUSPZENHJ-XSFVSMFZSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
7.1098 -4.7669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1087 -5.5864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8167 -5.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8149 -4.3580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5235 -4.7633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5238 -5.5819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3024 -5.8347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7835 -5.1722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3020 -4.5102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4020 -4.3585 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6944 -4.7672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9866 -4.3588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6946 -5.5844 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2790 -4.7676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5712 -4.3592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8635 -4.7679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5710 -3.5420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1557 -4.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8632 -3.1335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1555 -3.5423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6007 -5.1719 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5543 -3.7329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0073 -3.1258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2636 -2.3502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7173 -1.7435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9171 -1.9134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6661 -2.6955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2140 -3.2989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3693 -1.3070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5703 -1.4782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
1 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
14 15 1 0
15 16 1 0
15 17 1 0
16 18 1 0
17 19 1 0
18 20 1 0
20 19 1 0
8 21 2 0
9 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
26 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 407.47Molecular Weight (Monoisotopic): 407.1845AlogP: 2.85#Rotatable Bonds: 6Polar Surface Area: 79.90Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.41CX Basic pKa: 7.07CX LogP: 2.26CX LogD: 2.09Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.72Np Likeness Score: -1.38
References 1. Yao D,Ruhan A,Jiang J,Huang J,Wang J,Han W. (2020) Design, synthesis and biological evaluation of 2-indolinone derivatives as PAK1 inhibitors in MDA-MB-231 cells., 30 (17): [PMID:32738980 ] [10.1016/j.bmcl.2020.127355 ]