The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-[2-(octylcarbamoyl)phenyl]-N-(3-pyrrolidin-1-ylpropyl)pyridine-3-carboxamide ID: ALA4761781
PubChem CID: 162660115
Max Phase: Preclinical
Molecular Formula: C28H40N4O2
Molecular Weight: 464.65
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCNC(=O)c1ccccc1-c1cncc(C(=O)NCCCN2CCCC2)c1
Standard InChI: InChI=1S/C28H40N4O2/c1-2-3-4-5-6-9-15-31-28(34)26-14-8-7-13-25(26)23-20-24(22-29-21-23)27(33)30-16-12-19-32-17-10-11-18-32/h7-8,13-14,20-22H,2-6,9-12,15-19H2,1H3,(H,30,33)(H,31,34)
Standard InChI Key: KJFVXTZSNAXFBN-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
23.0533 -13.4423 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.0521 -14.2660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7602 -14.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4740 -14.2655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4711 -13.4387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7584 -13.0294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1814 -13.0234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8948 -13.4334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1784 -12.2020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.6051 -13.0180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3185 -13.4281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0288 -13.0127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7421 -13.4227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.8272 -14.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6313 -14.4064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0372 -13.6929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4839 -13.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7593 -15.4873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0493 -15.8942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0478 -16.7107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7554 -17.1211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4661 -16.7092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4642 -15.8941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1714 -15.4847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8796 -15.8924 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1703 -14.6675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.5868 -15.4829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2950 -15.8906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0022 -15.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7104 -15.8888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4176 -15.4794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1258 -15.8871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8330 -15.4776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5412 -15.8853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
3 18 1 0
23 24 1 0
24 25 1 0
24 26 2 0
25 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.65Molecular Weight (Monoisotopic): 464.3151AlogP: 5.05#Rotatable Bonds: 14Polar Surface Area: 74.33Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.97CX Basic pKa: 9.28CX LogP: 4.14CX LogD: 2.27Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.38Np Likeness Score: -1.07
References 1. Zhang B,Liao L,Wu F,Zhang F,Sun Z,Chen H,Luo C. (2020) Synthesis and structure-activity relationship studies of LLY-507 analogues as SMYD2 inhibitors., 30 (22): [PMID:33011288 ] [10.1016/j.bmcl.2020.127598 ]