6-{2-Oxo-4-[1-((S)-1,2,3,10-tetramethoxy-9-oxo-5,6,7,9-tetrahydro-benzo[a]heptalen-7-yl)-1H-[1,2,3]triazol-4-yl]-butyl}-chromen-2-one

ID: ALA4761855

PubChem CID: 162659072

Max Phase: Preclinical

Molecular Formula: C35H33N3O8

Molecular Weight: 623.66

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc2c(c(OC)c1OC)-c1ccc(OC)c(=O)cc1[C@@H](n1cc(CCC(=O)Cc3ccc4oc(=O)ccc4c3)nn1)CC2

Standard InChI:  InChI=1S/C35H33N3O8/c1-42-30-13-10-25-26(18-28(30)40)27(11-6-22-17-31(43-2)34(44-3)35(45-4)33(22)25)38-19-23(36-37-38)8-9-24(39)16-20-5-12-29-21(15-20)7-14-32(41)46-29/h5,7,10,12-15,17-19,27H,6,8-9,11,16H2,1-4H3/t27-/m0/s1

Standard InChI Key:  AHICLJKQPKKIEP-MHZLTWQESA-N

Molfile:  

 
     RDKit          2D

 46 51  0  0  0  0  0  0  0  0999 V2000
    6.8512   -4.4161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6436   -4.2263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2032   -3.9044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4975   -4.3006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2916   -4.7381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7876   -3.9044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4921   -5.1590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2115   -3.0830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3040   -5.5676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0068   -3.4999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7876   -3.0789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8512   -5.9019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6560   -6.0835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8281   -3.4999    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5057   -2.6662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8512   -2.5795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0386   -5.9184    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6478   -2.7694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4975   -5.1219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0860   -4.3130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0860   -2.6703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8417   -6.8760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7876   -5.5346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3761   -3.9044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0777   -1.8490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2474   -7.4331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3146   -4.1616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0957   -3.9078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0957   -3.0864    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3146   -2.8328    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8010   -4.3130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5078   -3.9028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2164   -4.3098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9232   -3.8997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2182   -5.1270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6318   -4.3067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6313   -5.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3390   -5.5299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3341   -3.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0424   -4.2983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0434   -5.1221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7534   -5.5309    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4670   -5.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4659   -4.2965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7514   -3.8832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1746   -5.5290    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  3  1  0
  5  2  2  0
  6  4  2  0
  7  1  2  0
  8  3  2  0
  9  5  1  0
 10  2  1  0
 11 15  2  0
 12  7  1  0
 13 12  2  0
 10 14  1  6
 15  8  1  0
 16  8  1  0
 17  9  2  0
 18 10  1  0
 19  4  1  0
 20  6  1  0
 21 11  1  0
 22 13  1  0
 23 19  1  0
 24 20  1  0
 25 21  1  0
 26 22  1  0
  9 13  1  0
 16 18  1  0
 11  6  1  0
 14 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 14  1  0
 28 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  2  0
 34 36  1  0
 36 37  2  0
 37 38  1  0
 38 41  2  0
 40 39  2  0
 39 36  1  0
 40 41  1  0
 40 45  1  0
 41 42  1  0
 42 43  1  0
 43 44  1  0
 44 45  2  0
 43 46  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4761855

    ---

Associated Targets(Human)

BJAB (157 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 623.66Molecular Weight (Monoisotopic): 623.2268AlogP: 4.73#Rotatable Bonds: 10
Polar Surface Area: 131.98Molecular Species: NEUTRALHBA: 11HBD:
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 0.33CX LogP: 4.22CX LogD: 4.22
Aromatic Rings: 5Heavy Atoms: 46QED Weighted: 0.20Np Likeness Score: 0.32

References

1. Gracheva IA,Shchegravina ES,Schmalz HG,Beletskaya IP,Fedorov AY.  (2020)  Colchicine Alkaloids and Synthetic Analogues: Current Progress and Perspectives.,  63  (19.0): [PMID:32432867] [10.1021/acs.jmedchem.0c00222]

Source