NA

ID: ALA4761881

PubChem CID: 162659452

Max Phase: Preclinical

Molecular Formula: C26H31FN6O4S

Molecular Weight: 542.64

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1CCS(=O)(=O)CCOc2ccc(F)cc2C(=O)N2CCCC[C@H]2c2cc3nc(N4CCC4)cc1n3n2

Standard InChI:  InChI=1S/C26H31FN6O4S/c1-30-11-13-38(35,36)14-12-37-22-7-6-18(27)15-19(22)26(34)32-10-3-2-5-21(32)20-16-24-28-23(31-8-4-9-31)17-25(30)33(24)29-20/h6-7,15-17,21H,2-5,8-14H2,1H3/t21-/m0/s1

Standard InChI Key:  ADNWHNZKDJRHDA-NRFANRHFSA-N

Molfile:  

 
     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
   35.8202   -8.7456    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.5301   -9.1542    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   36.5290   -8.3351    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.2111   -9.3399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3208  -12.1547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3208  -12.9719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0261  -13.3763    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.0261  -11.7420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7314  -12.1547    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.7359  -12.9729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5154  -13.2214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9928  -12.5568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5081  -11.8976    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.8077  -12.5519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2190  -13.2591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0326  -13.2565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4411  -12.5484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0298  -11.8411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2100  -11.8421    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.6145  -13.3832    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.8248  -13.1729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6144  -13.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4041  -14.1729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0261  -10.9248    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.3184  -10.5162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7982  -11.1362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2035  -10.4267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9810  -11.1399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.0205  -10.4247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4258   -9.7159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0139   -9.0091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1925   -9.0155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7909   -9.7248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9738   -9.7314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.1331   -9.8974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5928  -10.4284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2430   -9.7126    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   38.3915  -13.2567    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   37.3349  -10.1447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  6  1  0
  5  8  2  0
  6  7  2  0
  7 10  1  0
  9  8  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  9  1  0
 14 15  1  0
 14 19  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 12 14  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 20  1  0
  6 20  1  0
  8 24  1  0
 24 36  1  0
 24 25  1  0
 19 26  1  0
 26 27  1  0
 26 28  2  0
 27 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 27  1  0
 33 34  1  0
  2 35  1  0
 35 36  1  0
 30 37  1  0
 14 38  1  6
 34 39  1  0
 39  4  1  0
  4  2  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4761881

    ---

Associated Targets(non-human)

F Fusion glycoprotein F0 (67 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 542.64Molecular Weight (Monoisotopic): 542.2112AlogP: 2.69#Rotatable Bonds: 1
Polar Surface Area: 100.35Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 3.94CX LogP: 2.25CX LogD: 2.25
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.46Np Likeness Score: -1.42

References

1. Yamaguchi-Sasaki T,Kawaguchi T,Okada A,Tokura S,Tanaka-Yamamoto N,Takeuchi T,Ogata Y,Takahashi R,Kurimoto-Tsuruta R,Tamaoki T,Sugaya Y,Abe-Kumasaka T,Arikawa K,Yoshida I,Sugiyama H,Kanuma K,Yoshinaga M.  (2020)  Discovery of a potent dual inhibitor of wild-type and mutant respiratory syncytial virus fusion proteins through the modulation of atropisomer interconversion properties.,  28  (24): [PMID:33190073] [10.1016/j.bmc.2020.115818]

Source