The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-(9-(2-(2-(2-methoxyethoxy)ethoxy)ethyl)-9H-carbazol-3-yl)vinyl)pyridinium iodide ID: ALA4761998
PubChem CID: 162659075
Max Phase: Preclinical
Molecular Formula: C26H29IN2O3
Molecular Weight: 416.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COCCOCCOCCn1c2ccccc2c2cc(/C=C/c3ccncc3)ccc21.I
Standard InChI: InChI=1S/C26H28N2O3.HI/c1-29-16-17-31-19-18-30-15-14-28-25-5-3-2-4-23(25)24-20-22(8-9-26(24)28)7-6-21-10-12-27-13-11-21;/h2-13,20H,14-19H2,1H3;1H/b7-6+;
Standard InChI Key: FZXLZYSXQIOXCO-UHDJGPCESA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
14.7322 -5.9954 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
12.4559 -7.1244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4548 -7.9517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1695 -8.3645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8860 -7.9512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8830 -7.1207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1677 -6.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7414 -6.7121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0271 -7.1248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3126 -6.7124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3160 -5.8869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6023 -5.4747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6042 -7.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8900 -6.7166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8914 -5.8878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1035 -5.6303 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1011 -6.9713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6177 -6.3009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7974 -6.3852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4595 -7.1393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9481 -7.8099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7667 -7.7222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8487 -4.8456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0417 -4.6741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7869 -3.8894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9800 -3.7179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7251 -2.9332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9183 -2.7616 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6635 -1.9771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8565 -1.8054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6017 -1.0209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7948 -0.8493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
2 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 15 2 0
14 13 2 0
13 10 1 0
14 15 1 0
15 16 1 0
16 18 1 0
17 14 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
16 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 416.52Molecular Weight (Monoisotopic): 416.2100AlogP: 5.04#Rotatable Bonds: 11Polar Surface Area: 45.51Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.29CX LogP: 4.30CX LogD: 4.29Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.32Np Likeness Score: -0.69
References 1. Yu QQ,Wang MQ. (2020) Carbazole-based fluorescent probes for G-quadruplex DNA targeting with superior selectivity and low cytotoxicity., 28 (17): [PMID:32773092 ] [10.1016/j.bmc.2020.115641 ]