4-(2-(9-(2-(2-(2-methoxyethoxy)ethoxy)ethyl)-9H-carbazol-3-yl)vinyl)pyridinium iodide

ID: ALA4761998

PubChem CID: 162659075

Max Phase: Preclinical

Molecular Formula: C26H29IN2O3

Molecular Weight: 416.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COCCOCCOCCn1c2ccccc2c2cc(/C=C/c3ccncc3)ccc21.I

Standard InChI:  InChI=1S/C26H28N2O3.HI/c1-29-16-17-31-19-18-30-15-14-28-25-5-3-2-4-23(25)24-20-22(8-9-26(24)28)7-6-21-10-12-27-13-11-21;/h2-13,20H,14-19H2,1H3;1H/b7-6+;

Standard InChI Key:  FZXLZYSXQIOXCO-UHDJGPCESA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   14.7322   -5.9954    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   12.4559   -7.1244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4548   -7.9517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1695   -8.3645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8860   -7.9512    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.8830   -7.1207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1677   -6.7117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7414   -6.7121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0271   -7.1248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3126   -6.7124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3160   -5.8869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6023   -5.4747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6042   -7.1251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8900   -6.7166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8914   -5.8878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1035   -5.6303    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1011   -6.9713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6177   -6.3009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7974   -6.3852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4595   -7.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9481   -7.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7667   -7.7222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8487   -4.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0417   -4.6741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7869   -3.8894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9800   -3.7179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7251   -2.9332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9183   -2.7616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6635   -1.9771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8565   -1.8054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6017   -1.0209    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7948   -0.8493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  2  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 15  2  0
 14 13  2  0
 13 10  1  0
 14 15  1  0
 15 16  1  0
 16 18  1  0
 17 14  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 16 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
M  END

Associated Targets(Human)

quadruplex DNA (2700 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 416.52Molecular Weight (Monoisotopic): 416.2100AlogP: 5.04#Rotatable Bonds: 11
Polar Surface Area: 45.51Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 5.29CX LogP: 4.30CX LogD: 4.29
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.32Np Likeness Score: -0.69

References

1. Yu QQ,Wang MQ.  (2020)  Carbazole-based fluorescent probes for G-quadruplex DNA targeting with superior selectivity and low cytotoxicity.,  28  (17): [PMID:32773092] [10.1016/j.bmc.2020.115641]

Source