(+/-)-2-(5-(3-Chloro-4-((1-(2-fluorophenyl)ethyl)amino)quinolin-6-yl)-pyrimidin-2-yl)propan-2-ol

ID: ALA4762023

PubChem CID: 126531026

Max Phase: Preclinical

Molecular Formula: C24H22ClFN4O

Molecular Weight: 436.92

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(Nc1c(Cl)cnc2ccc(-c3cnc(C(C)(C)O)nc3)cc12)c1ccccc1F

Standard InChI:  InChI=1S/C24H22ClFN4O/c1-14(17-6-4-5-7-20(17)26)30-22-18-10-15(8-9-21(18)27-13-19(22)25)16-11-28-23(29-12-16)24(2,3)31/h4-14,31H,1-3H3,(H,27,30)

Standard InChI Key:  TZXWJHVVESOPPE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   12.2868   -6.5664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8318   -6.3518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6242   -6.5664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4139   -5.7729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3331   -6.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3331   -5.3370    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0422   -4.9284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7513   -5.3370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7513   -6.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0422   -6.5669    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5794   -3.7026    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2885   -4.1112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2885   -4.9284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5794   -5.3370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8744   -4.9284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1653   -5.3370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4563   -4.9284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4563   -4.1112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1653   -3.7026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8744   -4.1112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9976   -5.3370    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.5794   -6.1583    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2885   -7.3841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9976   -7.7927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9976   -8.6099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2885   -9.0185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5794   -8.6099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5794   -7.7927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6295   -7.3841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9940   -6.1570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7051   -7.3838    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0
  4  3  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  5 10  2  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 11 20  1  0
 15 20  1  0
 13 21  1  0
  1 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 23 28  2  0
 22  1  1  0
 14 22  1  0
  8 17  1  0
  3  5  1  0
  3 29  1  0
  1 30  1  0
 24 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4762023

    ---

Associated Targets(Human)

TNF Tclin TNF-alpha (1897 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 436.92Molecular Weight (Monoisotopic): 436.1466AlogP: 5.88#Rotatable Bonds: 5
Polar Surface Area: 70.93Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.36CX Basic pKa: 6.20CX LogP: 4.76CX LogD: 4.74
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.41Np Likeness Score: -1.08

References

1. Xiao HY,Li N,Duan JJ,Jiang B,Lu Z,Ngu K,Tino J,Kopcho LM,Lu H,Chen J,Tebben AJ,Sheriff S,Chang CY,Yanchunas J,Calambur D,Gao M,Shuster DJ,Susulic V,Xie JH,Guarino VR,Wu DR,Gregor KR,Goldstine CB,Hynes J,Macor JE,Salter-Cid L,Burke JR,Shaw PJ,Dhar TGM.  (2020)  Biologic-like In Vivo Efficacy with Small Molecule Inhibitors of TNFα Identified Using Scaffold Hopping and Structure-Based Drug Design Approaches.,  63  (23): [PMID:33261314] [10.1021/acs.jmedchem.0c01732]

Source