N-[4-[(1-bromo-2-naphthyl)oxy]-3-chloro-phenyl]-2-hydroxy-5-nitro-benzamide

ID: ALA4762099

PubChem CID: 162660131

Max Phase: Preclinical

Molecular Formula: C23H14BrClN2O5

Molecular Weight: 513.73

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(Oc2ccc3ccccc3c2Br)c(Cl)c1)c1cc([N+](=O)[O-])ccc1O

Standard InChI:  InChI=1S/C23H14BrClN2O5/c24-22-16-4-2-1-3-13(16)5-9-21(22)32-20-10-6-14(11-18(20)25)26-23(29)17-12-15(27(30)31)7-8-19(17)28/h1-12,28H,(H,26,29)

Standard InChI Key:  IEJXRODLMHJQCW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   16.5009   -5.0855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2091   -4.6706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2044   -3.8443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4953   -3.4410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9226   -5.0805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.6328   -4.6651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3434   -5.0795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0532   -4.6647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0504   -3.8425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3320   -3.4368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6252   -3.8498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3438   -5.9008    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   20.7601   -3.4302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.4741   -3.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1838   -3.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4783   -4.6564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.8920   -3.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6012   -3.4183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5974   -2.5961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8785   -2.1873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1763   -2.6053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7854   -4.6723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7908   -3.8535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0883   -3.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3759   -3.8442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3705   -4.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0775   -5.0793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5034   -5.9027    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   22.8937   -4.6471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.8688   -1.3703    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.5724   -0.9546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.1571   -0.9688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 22  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4 23  1  0
  2  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  7 12  1  0
  9 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 15  1  0
 22 23  2  0
 22 27  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
  1 28  1  0
 17 29  1  0
 30 31  1  0
 30 32  2  0
 20 30  1  0
M  CHG  2  30   1  31  -1
M  END

Alternative Forms

  1. Parent:

    ALA4762099

    ---

Associated Targets(Human)

STK39 Tchem STE20/SPS1-related proline-alanine-rich protein kinase (342 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 513.73Molecular Weight (Monoisotopic): 511.9775AlogP: 6.91#Rotatable Bonds: 5
Polar Surface Area: 101.70Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 5.58CX Basic pKa: CX LogP: 6.56CX LogD: 4.94
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.22Np Likeness Score: -1.27

References

1. Fujii S,Kikuchi E,Watanabe Y,Suzuyama H,Ishigami-Yuasa M,Mori T,Isobe K,Uchida S,Kagechika H.  (2020)  Structural development of N-(4-phenoxyphenyl)benzamide derivatives as novel SPAK inhibitors blocking WNK kinase signaling.,  30  (17): [PMID:32738993] [10.1016/j.bmcl.2020.127408]

Source