The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Biphenyl-3-yl)sulfonyl-(R)-leucyl-aminocyclopropanenitrile ID: ALA4762158
PubChem CID: 162660642
Max Phase: Preclinical
Molecular Formula: C22H25N3O3S
Molecular Weight: 411.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@@H](NS(=O)(=O)c1cccc(-c2ccccc2)c1)C(=O)NC1(C#N)CC1
Standard InChI: InChI=1S/C22H25N3O3S/c1-16(2)13-20(21(26)24-22(15-23)11-12-22)25-29(27,28)19-10-6-9-18(14-19)17-7-4-3-5-8-17/h3-10,14,16,20,25H,11-13H2,1-2H3,(H,24,26)/t20-/m1/s1
Standard InChI Key: TXNDJCXNKMIHRP-HXUWFJFHSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
44.6195 -14.3793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2150 -13.6735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8060 -14.3767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2611 -12.5674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.6738 -13.2773 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
41.0823 -12.5649 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.5552 -13.6941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5540 -14.5136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2621 -14.9226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9717 -14.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9689 -13.6905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2603 -13.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3843 -13.6852 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.0905 -13.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7997 -13.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5059 -13.2686 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.8028 -14.4970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.9213 -13.2632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6256 -12.8499 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.0874 -12.4567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7935 -12.0455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2637 -15.7376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5543 -16.1454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5537 -16.9619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2619 -17.3715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9720 -16.9587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9691 -16.1436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5028 -12.4514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7905 -11.2283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
1 3 1 0
5 4 2 0
6 5 2 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
11 5 1 0
5 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 2 1 0
2 18 1 0
18 19 3 0
14 20 1 6
20 21 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
9 22 1 0
21 28 1 0
21 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 411.53Molecular Weight (Monoisotopic): 411.1617AlogP: 3.22#Rotatable Bonds: 8Polar Surface Area: 99.06Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.04CX Basic pKa: ┄CX LogP: 3.40CX LogD: 3.40Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.70Np Likeness Score: -1.12
References 1. Lemke C,Cianni L,Feldmann C,Gilberg E,Yin J,Dos Reis Rocho F,de Vita D,Bartz U,Bajorath J,Montanari CA,Gütschow M. (2020) N-Sulfonyl dipeptide nitriles as inhibitors of human cathepsin S: In silico design, synthesis and biochemical characterization., 30 (18): [PMID:32763808 ] [10.1016/j.bmcl.2020.127420 ]