The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-N-[(1R,2R)-2-(benzyloxy)-1-cyanopropyl]-2-({[1,1'-biphenyl]-4-yl}formamido)-3-(3-chlorophenyl)propanamide ID: ALA4762161
PubChem CID: 162660645
Max Phase: Preclinical
Molecular Formula: C33H30ClN3O3
Molecular Weight: 552.07
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](OCc1ccccc1)[C@@H](C#N)NC(=O)[C@H](Cc1cccc(Cl)c1)NC(=O)c1ccc(-c2ccccc2)cc1
Standard InChI: InChI=1S/C33H30ClN3O3/c1-23(40-22-24-9-4-2-5-10-24)31(21-35)37-33(39)30(20-25-11-8-14-29(34)19-25)36-32(38)28-17-15-27(16-18-28)26-12-6-3-7-13-26/h2-19,23,30-31H,20,22H2,1H3,(H,36,38)(H,37,39)/t23-,30+,31-/m1/s1
Standard InChI Key: UTUPIYLIWLYEQC-YYSPBGNDSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
17.5036 -5.3571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2154 -4.9444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9231 -5.3571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9231 -6.1785 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.6350 -4.9444 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3434 -5.3517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3449 -6.1689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0534 -6.5762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0549 -7.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7633 -7.8007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7616 -8.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4692 -9.0259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1772 -8.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1730 -7.7946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4649 -7.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2164 -4.1272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9247 -3.7195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6300 -4.1326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3377 -3.7256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3392 -2.9075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6270 -2.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9222 -2.9076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6252 -1.6810 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
21.0504 -4.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6380 -6.5788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7551 -4.5313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7951 -4.9498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7936 -4.1327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0882 -5.3597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3825 -4.9506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6760 -5.3598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6771 -6.1779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3905 -6.5850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0941 -6.1735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9729 -6.5883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2636 -6.1803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5577 -6.5904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5598 -7.4085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2738 -7.8147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9768 -7.4022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
3 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
2 16 1 1
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
21 23 1 0
6 24 1 6
7 25 1 6
24 26 3 0
1 27 1 0
27 28 2 0
27 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 552.07Molecular Weight (Monoisotopic): 551.1976AlogP: 5.96#Rotatable Bonds: 11Polar Surface Area: 91.22Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.50CX Basic pKa: ┄CX LogP: 6.26CX LogD: 6.26Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.24Np Likeness Score: -0.56
References 1. Cianni L,Rocho FDR,Bonatto V,Martins FCP,Lameira J,Leitão A,Montanari CA,Shamim A. (2021) Design, synthesis and stepwise optimization of nitrile-based inhibitors of cathepsins B and L., 29 [PMID:33254069 ] [10.1016/j.bmc.2020.115827 ]