The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2[[2-(4-hydroxyanilino)-2-oxo-ethyl]sulfamoyl]-N-(2-phenylethyl)benzamide ID: ALA4762179
PubChem CID: 146660842
Max Phase: Preclinical
Molecular Formula: C23H23N3O5S
Molecular Weight: 453.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CNS(=O)(=O)c1ccccc1C(=O)NCCc1ccccc1)Nc1ccc(O)cc1
Standard InChI: InChI=1S/C23H23N3O5S/c27-19-12-10-18(11-13-19)26-22(28)16-25-32(30,31)21-9-5-4-8-20(21)23(29)24-15-14-17-6-2-1-3-7-17/h1-13,25,27H,14-16H2,(H,24,29)(H,26,28)
Standard InChI Key: RPCHOOHBCZMYSY-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
5.9497 -28.4926 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4209 -27.8153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5973 -27.7449 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.4571 -28.1638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4559 -28.9912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1708 -29.4041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8872 -28.9908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8844 -28.1602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1690 -27.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1665 -26.9260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8797 -26.5113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4507 -26.5156 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5942 -26.9200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3072 -26.5047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0232 -26.9145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0263 -27.7396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7362 -26.4994 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4522 -26.9092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4507 -27.7316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1659 -28.1413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8799 -27.7260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8741 -26.8967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1583 -26.4908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5965 -28.1349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4483 -25.6906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7326 -25.2802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7301 -24.4551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4426 -24.0450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4405 -23.2208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7243 -22.8096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0086 -23.2286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0143 -24.0516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 2 0
1 3 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
9 10 1 0
10 11 2 0
10 12 1 0
8 3 1 0
3 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 24 1 0
12 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.52Molecular Weight (Monoisotopic): 453.1358AlogP: 2.28#Rotatable Bonds: 9Polar Surface Area: 124.60Molecular Species: NEUTRALHBA: 5HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.13CX Basic pKa: ┄CX LogP: 2.50CX LogD: 2.49Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.37Np Likeness Score: -1.35
References 1. Bazan HA,Bhattacharjee S,Burgos C,Recio J,Abet V,Pahng AR,Jun B,Heap J,Ledet AJ,Gordon WC,Edwards S,Paul D,Alvarez-Builla J,Bazan NG. (2020) A novel pipeline of 2-(benzenesulfonamide)-N-(4-hydroxyphenyl) acetamide analgesics that lack hepatotoxicity and retain antipyresis., 202 [PMID:32629335 ] [10.1016/j.ejmech.2020.112600 ]