2[[2-(4-hydroxyanilino)-2-oxo-ethyl]sulfamoyl]-N-(2-phenylethyl)benzamide

ID: ALA4762179

PubChem CID: 146660842

Max Phase: Preclinical

Molecular Formula: C23H23N3O5S

Molecular Weight: 453.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CNS(=O)(=O)c1ccccc1C(=O)NCCc1ccccc1)Nc1ccc(O)cc1

Standard InChI:  InChI=1S/C23H23N3O5S/c27-19-12-10-18(11-13-19)26-22(28)16-25-32(30,31)21-9-5-4-8-20(21)23(29)24-15-14-17-6-2-1-3-7-17/h1-13,25,27H,14-16H2,(H,24,29)(H,26,28)

Standard InChI Key:  RPCHOOHBCZMYSY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
    5.9497  -28.4926    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4209  -27.8153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5973  -27.7449    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.4571  -28.1638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4559  -28.9912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1708  -29.4041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8872  -28.9908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8844  -28.1602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1690  -27.7510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1665  -26.9260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8797  -26.5113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4507  -26.5156    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5942  -26.9200    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3072  -26.5047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0232  -26.9145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0263  -27.7396    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7362  -26.4994    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4522  -26.9092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4507  -27.7316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1659  -28.1413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8799  -27.7260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8741  -26.8967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1583  -26.4908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5965  -28.1349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4483  -25.6906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7326  -25.2802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7301  -24.4551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4426  -24.0450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4405  -23.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7243  -22.8096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0086  -23.2286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0143  -24.0516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  1  3  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
  8  3  1  0
  3 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 12 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4762179

    ---

Associated Targets(Human)

Hepatocyte (2737 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 453.52Molecular Weight (Monoisotopic): 453.1358AlogP: 2.28#Rotatable Bonds: 9
Polar Surface Area: 124.60Molecular Species: NEUTRALHBA: 5HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.13CX Basic pKa: CX LogP: 2.50CX LogD: 2.49
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.37Np Likeness Score: -1.35

References

1. Bazan HA,Bhattacharjee S,Burgos C,Recio J,Abet V,Pahng AR,Jun B,Heap J,Ledet AJ,Gordon WC,Edwards S,Paul D,Alvarez-Builla J,Bazan NG.  (2020)  A novel pipeline of 2-(benzenesulfonamide)-N-(4-hydroxyphenyl) acetamide analgesics that lack hepatotoxicity and retain antipyresis.,  202  [PMID:32629335] [10.1016/j.ejmech.2020.112600]

Source