The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-fluoro-2-[4-(2-fluorophenyl)phenyl]-3-methyl-N-methylsulfonyl-quinoline-4-carboxamide ID: ALA4762268
PubChem CID: 162659635
Max Phase: Preclinical
Molecular Formula: C24H18F2N2O3S
Molecular Weight: 452.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(-c2ccc(-c3ccccc3F)cc2)nc2ccc(F)cc2c1C(=O)NS(C)(=O)=O
Standard InChI: InChI=1S/C24H18F2N2O3S/c1-14-22(24(29)28-32(2,30)31)19-13-17(25)11-12-21(19)27-23(14)16-9-7-15(8-10-16)18-5-3-4-6-20(18)26/h3-13H,1-2H3,(H,28,29)
Standard InChI Key: KKGKBXNTBPRTCQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
25.5929 -25.3082 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.7716 -25.3082 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.1802 -26.0200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3463 -22.0270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3452 -22.8506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0573 -23.2637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0556 -21.6181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7683 -22.0234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7691 -22.8465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4817 -23.2577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1941 -22.8428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1894 -22.0165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4761 -21.6131 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.9034 -23.2527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8946 -21.6036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6098 -22.0134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3186 -21.6012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3141 -20.7790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5948 -20.3708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8889 -20.7894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0208 -20.3617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7360 -20.7709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4443 -20.3536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4387 -19.5315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7188 -19.1283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0135 -19.5438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2975 -19.1424 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.6330 -23.2628 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
25.4834 -24.0790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7724 -24.4891 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1961 -24.4862 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0631 -25.7246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
11 14 1 0
12 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
18 21 1 0
26 27 1 0
5 28 1 0
10 29 1 0
29 30 1 0
29 31 2 0
30 2 1 0
2 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.48Molecular Weight (Monoisotopic): 452.1006AlogP: 4.84#Rotatable Bonds: 4Polar Surface Area: 76.13Molecular Species: ACIDHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.09CX Basic pKa: 1.27CX LogP: 4.94CX LogD: 4.00Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -1.08
References 1. DeRatt LG,Christine Pietsch E,Tanner A,Shaffer P,Jacoby E,Wang W,Kazmi F,Zhang X,Attar RM,Edwards JP,Kuduk SD. (2020) A carboxylic acid isostere screen of the DHODH inhibitor Brequinar., 30 (22): [PMID:33007394 ] [10.1016/j.bmcl.2020.127589 ]