The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S,Z)-N-(1-bromo-3-((1-hydroxy-3-phenylpropan-2-yl)amino)-3-oxo-1-phenylprop-1-en-2-yl)-2-methoxybenzamide ID: ALA4762386
PubChem CID: 162660668
Max Phase: Preclinical
Molecular Formula: C26H25BrN2O4
Molecular Weight: 509.40
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1C(=O)N/C(C(=O)N[C@H](CO)Cc1ccccc1)=C(\Br)c1ccccc1
Standard InChI: InChI=1S/C26H25BrN2O4/c1-33-22-15-9-8-14-21(22)25(31)29-24(23(27)19-12-6-3-7-13-19)26(32)28-20(17-30)16-18-10-4-2-5-11-18/h2-15,20,30H,16-17H2,1H3,(H,28,32)(H,29,31)/b24-23-/t20-/m0/s1
Standard InChI Key: XTNXJVRACRUJCX-NVWMPKGRSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
25.6906 -16.9918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6894 -17.8113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3975 -18.2203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1071 -17.8108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1043 -16.9882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3957 -16.5829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3973 -19.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6895 -19.4459 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
27.1049 -19.4462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1047 -20.2634 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.8127 -19.0378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5203 -19.4466 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.8129 -18.2206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2281 -19.0381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9357 -19.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2283 -18.2210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9361 -17.8125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9355 -20.2641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8123 -20.6722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8121 -21.4894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5201 -20.2638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.1052 -21.8956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1047 -22.7120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8128 -23.1216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5230 -22.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5201 -21.8937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2281 -20.6683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2276 -21.4847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9357 -21.8943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6459 -21.4815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6429 -20.6664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3981 -21.4860 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.3992 -20.6688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 1 0
7 9 2 0
9 10 1 0
9 11 1 0
11 12 1 0
11 13 2 0
14 12 1 6
14 15 1 0
14 16 1 0
16 17 1 0
15 18 1 0
10 19 1 0
19 20 1 0
19 21 2 0
20 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 20 1 0
18 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 18 1 0
22 32 1 0
32 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.40Molecular Weight (Monoisotopic): 508.0998AlogP: 3.91#Rotatable Bonds: 9Polar Surface Area: 87.66Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.87CX Basic pKa: ┄CX LogP: 3.61CX LogD: 3.61Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.38Np Likeness Score: -0.42
References 1. Gu X,Zhang Y,Zou Y,Li X,Guan M,Zhou Q,Qiu J. (2021) Synthesis and evaluation of new phenyl acrylamide derivatives as potent non-nucleoside anti-HBV agents., 29 [PMID:33285406 ] [10.1016/j.bmc.2020.115892 ]