The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(Benzofuran-2-ylmethyl)-N-(2-((bis(4-fluorophenyl)methyl)thio)ethyl)piperidin-4-amine ID: ALA4762414
PubChem CID: 142590723
Max Phase: Preclinical
Molecular Formula: C29H30F2N2OS
Molecular Weight: 492.64
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Fc1ccc(C(SCCNC2CCN(Cc3cc4ccccc4o3)CC2)c2ccc(F)cc2)cc1
Standard InChI: InChI=1S/C29H30F2N2OS/c30-24-9-5-21(6-10-24)29(22-7-11-25(31)12-8-22)35-18-15-32-26-13-16-33(17-14-26)20-27-19-23-3-1-2-4-28(23)34-27/h1-12,19,26,29,32H,13-18,20H2
Standard InChI Key: FYWRHDFLQYAZFC-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
34.3949 -26.0758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3938 -26.8995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1059 -27.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8156 -26.8990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8128 -26.0722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1041 -25.6669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5281 -27.3106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5294 -28.1319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2393 -26.8968 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
37.9517 -27.3084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6629 -26.8945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3754 -27.3062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.8169 -28.5401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8178 -29.3606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5308 -29.7730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2443 -29.3548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2399 -28.5356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6830 -25.6674 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
36.5332 -30.5944 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
40.0866 -26.8923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7950 -27.3039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0853 -26.0710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7924 -25.6613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5049 -26.0688 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.2161 -25.6591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5061 -26.8901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9285 -26.0666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0185 -26.8815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.6819 -25.7313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2339 -26.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8217 -27.0515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2328 -27.7556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.0518 -27.7553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4580 -27.0450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.0487 -26.3397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
7 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
8 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 8 1 0
1 18 1 0
15 19 1 0
12 20 1 0
20 21 1 0
20 22 1 0
22 23 1 0
21 26 1 0
23 24 1 0
24 25 1 0
24 26 1 0
25 27 1 0
27 28 1 0
28 31 1 0
30 29 1 0
29 27 2 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.64Molecular Weight (Monoisotopic): 492.2047AlogP: 6.79#Rotatable Bonds: 9Polar Surface Area: 28.41Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.95CX LogP: 6.02CX LogD: 3.48Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.26Np Likeness Score: -0.91
References 1. Giancola JB,Bonifazi A,Cao J,Ku T,Haraczy AJ,Lam J,Rais R,Coggiano MA,Tanda G,Newman AH. (2020) Structure-activity relationships for a series of (Bis(4-fluorophenyl)methyl)sulfinylethyl-aminopiperidines and -piperidine amines at the dopamine transporter: Bioisosteric replacement of the piperazine improves metabolic stability., 208 [PMID:32947229 ] [10.1016/j.ejmech.2020.112674 ]