N'-((1H-imidazol-2-yl)methylene)-2,2-diphenylcyclopropanecarbohydrazide

ID: ALA4762459

PubChem CID: 162660012

Max Phase: Preclinical

Molecular Formula: C20H18N4O

Molecular Weight: 330.39

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(N/N=C/c1ncc[nH]1)C1CC1(c1ccccc1)c1ccccc1

Standard InChI:  InChI=1S/C20H18N4O/c25-19(24-23-14-18-21-11-12-22-18)17-13-20(17,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-12,14,17H,13H2,(H,21,22)(H,24,25)/b23-14+

Standard InChI Key:  MYBLLDBMSFVRLE-OEAKJJBVSA-N

Molfile:  

 
     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
    3.4643   -3.6645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6897   -2.8767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8896   -2.7090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5069   -2.8767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0983   -2.1673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6379   -1.9315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8386   -1.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2923   -2.3731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5510   -3.1531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3497   -3.3173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6707   -3.8584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4452   -4.6454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0150   -5.2355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8135   -5.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0353   -4.2466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2144   -3.2856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2140   -4.1028    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9224   -2.8774    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6298   -3.2864    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3378   -2.8781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0453   -3.2871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1276   -4.0987    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9269   -4.2690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3358   -3.5614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7893   -2.9540    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  2  1  0
  5  4  1  0
  2  5  1  0
  3  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  3  1  0
  1 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15  1  1  0
  4 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 21  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4762459

    ---

Associated Targets(non-human)

Human alphaherpesvirus 1 (11089 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 330.39Molecular Weight (Monoisotopic): 330.1481AlogP: 2.87#Rotatable Bonds: 5
Polar Surface Area: 70.14Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.34CX Basic pKa: 5.46CX LogP: 3.29CX LogD: 3.29
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.56Np Likeness Score: -0.76

References

1. McNulty J,Babu Dokuburra C,D'Aiuto L,Demers M,McClain L,Piazza P,Williamson K,Zheng W,Nimgaonkar VL.  (2020)  Synthesis of non-nucleoside anti-viral cyclopropylcarboxacyl hydrazones and initial anti-HSV-1 structure-activity relationship studies.,  30  (24): [PMID:32961320] [10.1016/j.bmcl.2020.127559]

Source