The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-(2'-(tert-Butyl)-7'-oxo-6',7'-dihydro-2'H-spiro[piperidine-4,5'-pyrano[3,2-c]pyrazole]-1-carbonyl)-6-(dimethylamino)-pyridin-2-yl)benzoic Acid ID: ALA4762472
PubChem CID: 162660340
Max Phase: Preclinical
Molecular Formula: C29H33N5O5
Molecular Weight: 531.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1cc(C(=O)N2CCC3(CC2)CC(=O)c2nn(C(C)(C)C)cc2O3)cc(-c2ccc(C(=O)O)cc2)n1
Standard InChI: InChI=1S/C29H33N5O5/c1-28(2,3)34-17-23-25(31-34)22(35)16-29(39-23)10-12-33(13-11-29)26(36)20-14-21(30-24(15-20)32(4)5)18-6-8-19(9-7-18)27(37)38/h6-9,14-15,17H,10-13,16H2,1-5H3,(H,37,38)
Standard InChI Key: KFLUNUSHNNCWKD-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
35.0732 -3.8672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0691 -4.6844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7708 -5.0943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4812 -4.6915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.4853 -3.8743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7791 -3.4599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3711 -4.2717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.0764 -3.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3711 -2.6373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6658 -3.8672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6658 -3.0501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8887 -2.7975 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.4083 -3.4586 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8886 -4.1196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1862 -5.1047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1810 -5.9219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.8966 -4.7006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5977 -5.1150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6032 -3.4806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8962 -3.8864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3132 -3.8936 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.3102 -4.7074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5911 -3.4586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1825 -2.7509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1825 -4.1663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7726 -3.4545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3711 -1.8201 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.0162 -5.1177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0117 -5.9360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7171 -6.3472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4273 -5.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4278 -5.1198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7219 -4.7123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1340 -6.3516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1320 -7.1688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.8427 -5.9448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.6055 -2.6634 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.3144 -2.2569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8990 -2.2528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
11 9 1 0
10 7 1 0
7 1 1 0
1 8 1 0
8 9 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 10 2 0
4 15 1 0
15 16 2 0
15 17 1 0
17 18 2 0
18 22 1 0
21 19 1 0
19 20 2 0
20 17 1 0
21 22 2 0
13 23 1 0
23 24 1 0
23 25 1 0
23 26 1 0
9 27 2 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
22 28 1 0
31 34 1 0
34 35 2 0
34 36 1 0
19 37 1 0
37 38 1 0
37 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 531.61Molecular Weight (Monoisotopic): 531.2482AlogP: 4.10#Rotatable Bonds: 4Polar Surface Area: 117.86Molecular Species: ACIDHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 2.66CX Basic pKa: 5.25CX LogP: 2.08CX LogD: 0.22Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.53Np Likeness Score: -1.01
References 1. Huard K,Smith AC,Cappon G,Dow RL,Edmonds DJ,El-Kattan A,Esler WP,Fernando DP,Griffith DA,Kalgutkar AS,Ross TT,Bagley SW,Beebe D,Bi YA,Cabral S,Crowley C,Doran SD,Dowling MS,Liras S,Mascitti V,Niosi M,Pfefferkorn JA,Polivkova J,Préville C,Price DA,Shavnya A,Shirai N,Smith AH,Southers JR,Tess DA,Thuma BA,Varma MV,Yang X. (2020) Optimizing the Benefit/Risk of Acetyl-CoA Carboxylase Inhibitors through Liver Targeting., 63 (19.0): [PMID:32809824 ] [10.1021/acs.jmedchem.0c00640 ]