(3S,4R,5S,6S)-2,3,6,7-Tetrabenzyl-2,3,6,7-tetrahydro-4,5-dihydroxy-1,2,7-thiadiazepane-1,1-dioxide

ID: ALA4762491

PubChem CID: 60147542

Max Phase: Preclinical

Molecular Formula: C32H34N2O4S

Molecular Weight: 542.70

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=S1(=O)N(Cc2ccccc2)[C@@H](Cc2ccccc2)[C@H](O)[C@H](O)[C@H](Cc2ccccc2)N1Cc1ccccc1

Standard InChI:  InChI=1S/C32H34N2O4S/c35-31-29(21-25-13-5-1-6-14-25)33(23-27-17-9-3-10-18-27)39(37,38)34(24-28-19-11-4-12-20-28)30(32(31)36)22-26-15-7-2-8-16-26/h1-20,29-32,35-36H,21-24H2/t29-,30-,31-,32+/m0/s1

Standard InChI Key:  NWHNYGAGGFJRFR-RTNMLALUSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    7.1236  -21.5772    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5404  -22.2912    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.9530  -21.5747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8000  -22.6405    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2802  -22.6600    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6091  -23.4411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4568  -23.4607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1131  -24.0902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9354  -24.0960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2558  -23.6503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8064  -23.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5575  -24.3972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4891  -24.4377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7538  -24.5659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5006  -25.3475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0546  -25.9574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8608  -25.7803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1061  -24.9989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9245  -25.0336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1572  -25.8203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9569  -26.0106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5237  -25.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2840  -24.6236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1625  -22.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3945  -22.4105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9277  -22.1521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6898  -22.4614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8026  -23.2749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5640  -23.5802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2083  -23.0721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0905  -22.2550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3291  -21.9535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7650  -21.8936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9976  -22.1834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8666  -22.9950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5050  -23.5161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2699  -23.2194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2865  -24.8358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7524  -24.8234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  2  1  0
  2  5  1  0
  4  6  1  0
  5  7  1  0
  6  8  1  0
  7  9  1  0
  8  9  1  0
  7 10  1  1
  6 11  1  6
 11 12  1  0
 10 13  1  0
 12 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 12  1  0
 13 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 13  1  0
  4 24  1  0
 24 25  1  0
  5 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 25 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 25  1  0
  9 38  1  1
  8 39  1  1
M  END

Associated Targets(Human)

Panel NCI-60 (60 carcinoma cell lines) (1088 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
RPMI-8226 (44974 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 542.70Molecular Weight (Monoisotopic): 542.2239AlogP: 4.19#Rotatable Bonds: 8
Polar Surface Area: 81.08Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.20CX Basic pKa: CX LogP: 5.07CX LogD: 5.07
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.35Np Likeness Score: -0.02

References

1. Jun JJ,Duscharla D,Ummanni R,Hanson PR,Malhotra SV.  (2021)  Investigation on the Anticancer Activity of Symmetric and Unsymmetric Cyclic Sulfamides.,  12  (2.0): [PMID:33603966] [10.1021/acsmedchemlett.0c00460]

Source