The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ent-6beta,7beta-dihydroxy-(14beta-O-(O2-methoxyacyl-1-(pyrrolidin-1-yl)diazen-1-ium-1,2-diolate)butyryl)-1,15-dioxo-7,20-epoxy-16-kaurene ID: ALA4762493
PubChem CID: 162660553
Max Phase: Preclinical
Molecular Formula: C30H41N3O11
Molecular Weight: 619.67
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=C1C(=O)[C@]23[C@H](OC(=O)CCCC(=O)OCO/N=[N+](\[O-])N4CCCC4)[C@H]1CC[C@H]2[C@@]12CO[C@@]3(O)[C@@H](O)[C@@H]1C(C)(C)CCC2=O
Standard InChI: InChI=1S/C30H41N3O11/c1-17-18-9-10-19-28-15-42-30(39,25(38)23(28)27(2,3)12-11-20(28)34)29(19,24(17)37)26(18)44-22(36)8-6-7-21(35)41-16-43-31-33(40)32-13-4-5-14-32/h18-19,23,25-26,38-39H,1,4-16H2,2-3H3/b33-31-/t18-,19-,23+,25-,26+,28+,29-,30-/m0/s1
Standard InChI Key: IOWVOMWIFMCWGE-XNZNWGJOSA-N
Molfile:
RDKit 2D
47 52 0 0 0 0 0 0 0 0999 V2000
19.5754 -21.7299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1875 -21.0489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7909 -21.7273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5042 -21.0537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1647 -20.6834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8475 -20.6774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8545 -19.9098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2037 -19.5305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5374 -19.8978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5304 -20.6654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5111 -19.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1682 -19.9206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8265 -19.5532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8380 -18.7780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1809 -18.3923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5165 -18.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4975 -19.1586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8165 -20.3018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2121 -18.7422 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1586 -20.2771 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
20.4994 -21.8420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8478 -19.1215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3761 -20.3555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.2086 -20.9828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.9680 -20.1409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8330 -17.9865 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
21.1851 -19.1338 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
21.5648 -21.3790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.2802 -18.9571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9364 -20.9492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6195 -21.3807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2176 -21.3260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.3343 -21.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0258 -21.4394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7486 -21.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4401 -21.4938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.7800 -20.2418 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.1630 -21.1127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8545 -21.5482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5774 -21.1671 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.2689 -21.6026 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.9918 -21.2215 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.7213 -21.5814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2911 -20.9956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9100 -20.2726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1047 -20.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2375 -22.4192 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
7 11 1 0
6 4 1 0
4 5 1 0
5 12 1 0
6 7 1 0
6 2 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 2 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
14 17 1 0
12 18 1 1
17 18 1 0
8 19 2 0
6 20 1 1
4 21 1 1
7 22 1 6
22 23 1 0
5 23 1 0
18 24 2 0
13 25 1 1
14 26 1 6
11 27 1 1
5 28 1 1
17 29 2 0
25 30 1 0
30 31 1 0
30 32 2 0
31 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
35 37 2 0
36 38 1 0
38 39 1 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 1 0
43 44 1 0
44 45 1 0
45 46 1 0
46 42 1 0
41 47 1 0
M CHG 2 41 1 47 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 619.67Molecular Weight (Monoisotopic): 619.2741AlogP: 1.71#Rotatable Bonds: 9Polar Surface Area: 187.33Molecular Species: ACIDHBA: 12HBD: 2#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.03CX Basic pKa: ┄CX LogP: -0.69CX LogD: 1.34Aromatic Rings: ┄Heavy Atoms: 44QED Weighted: 0.07Np Likeness Score: 2.26
References 1. Xu S,Wang G,Lin Y,Zhang Y,Pei L,Yao H,Hu M,Qiu Y,Huang Z,Zhang Y,Xu J. (2016) Novel anticancer oridonin derivatives possessing a diazen-1-ium-1,2-diolate nitric oxide donor moiety: Design, synthesis, biological evaluation and nitric oxide release studies., 26 (12.0): [PMID:27158140 ] [10.1016/j.bmcl.2016.04.068 ]