(R)-methyl 2-(3-(1,2,3,5,6,7-hexahydros-indacen-4-yl)ureido)-3-(pyridin-3-yl)propanoate

ID: ALA4762524

PubChem CID: 146558463

Max Phase: Preclinical

Molecular Formula: C22H25N3O3

Molecular Weight: 379.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)[C@@H](Cc1cccnc1)NC(=O)Nc1c2c(cc3c1CCC3)CCC2

Standard InChI:  InChI=1S/C22H25N3O3/c1-28-21(26)19(11-14-5-4-10-23-13-14)24-22(27)25-20-17-8-2-6-15(17)12-16-7-3-9-18(16)20/h4-5,10,12-13,19H,2-3,6-9,11H2,1H3,(H2,24,25,27)/t19-/m1/s1

Standard InChI Key:  PMSRMYZMZCFBKK-LJQANCHMSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   27.9139  -10.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3439  -11.7013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6275  -12.1146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9130  -11.7048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3024  -12.2577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6396  -13.0093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4585  -12.9208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0592  -12.1124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.7728  -11.6986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4880  -12.1097    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.7712  -10.8736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.6258  -10.4569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3405  -10.8699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9542  -10.3179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6187   -9.5635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7978   -9.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2016  -11.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9169  -12.1070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6305  -11.6931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.9184  -12.9320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.3457  -12.1043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2000  -10.8709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9137  -10.4571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6298  -10.8704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3430  -10.4572    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.3419   -9.6314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6216   -9.2204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9114   -9.6359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  4  2  0
  3  2  2  0
  2 13  1  0
 12  1  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  3  1  0
  2  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 12  1  0
 10 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 17 22  1  6
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4762524

    ---

Associated Targets(Human)

NLRP3 Tchem NACHT, LRR and PYD domains-containing protein 3 (908 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 379.46Molecular Weight (Monoisotopic): 379.1896AlogP: 2.96#Rotatable Bonds: 5
Polar Surface Area: 80.32Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.66CX Basic pKa: 4.92CX LogP: 3.75CX LogD: 3.75
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.78Np Likeness Score: -0.63

References

1. Harrison D,Boutard N,Brzozka K,Bugaj M,Chmielewski S,Cierpich A,Doedens JR,Fabritius CRY,Gabel CA,Galezowski M,Kowalczyk P,Levenets O,Mroczkowska M,Palica K,Porter RA,Schultz D,Sowinska M,Topolnicki G,Urbanski P,Woyciechowski J,Watt AP.  (2020)  Discovery of a series of ester-substituted NLRP3 inflammasome inhibitors.,  30  (23): [PMID:32956781] [10.1016/j.bmcl.2020.127560]

Source