The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
9-O-(4-methoxybenzyl)berberine bromide ID: ALA4762533
PubChem CID: 162659325
Max Phase: Preclinical
Molecular Formula: C27H24BrNO5
Molecular Weight: 442.49
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(COc2c(OC)ccc3cc4[n+](cc23)CCc2cc3c(cc2-4)OCO3)cc1.[Br-]
Standard InChI: InChI=1S/C27H24NO5.BrH/c1-29-20-6-3-17(4-7-20)15-31-27-22-14-28-10-9-19-12-25-26(33-16-32-25)13-21(19)23(28)11-18(22)5-8-24(27)30-2;/h3-8,11-14H,9-10,15-16H2,1-2H3;1H/q+1;/p-1
Standard InChI Key: FEFQHFRSCLMQIH-UHFFFAOYSA-M
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
8.1360 -14.8973 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
2.6258 -14.4246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6246 -15.2501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3378 -15.6619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3360 -14.0128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0497 -14.4209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0505 -15.2459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7641 -15.6559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7584 -14.0078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4726 -14.4141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4744 -15.2437 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1899 -15.6547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9081 -15.2407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1863 -13.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9057 -14.4108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6229 -13.9955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1836 -13.1693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8978 -12.7517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6197 -13.1638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2348 -12.6046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8930 -11.8468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0668 -11.9378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3397 -16.4850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6278 -16.8982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9115 -15.6610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1990 -15.2489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6297 -17.7213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9145 -18.1304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9160 -18.9526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6303 -19.3634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3445 -18.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3395 -18.1248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6333 -20.1865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9220 -20.6006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
7 8 1 0
8 11 2 0
10 9 2 0
9 6 1 0
10 11 1 0
10 14 1 0
11 12 1 0
12 13 1 0
13 15 1 0
14 15 2 0
15 16 1 0
16 19 2 0
18 17 2 0
17 14 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 18 1 0
4 23 1 0
23 24 1 0
3 25 1 0
25 26 1 0
24 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
33 34 1 0
M CHG 2 1 -1 11 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.49Molecular Weight (Monoisotopic): 442.1649AlogP: 4.68#Rotatable Bonds: 5Polar Surface Area: 50.03Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 0.28CX LogD: 0.28Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.42Np Likeness Score: 0.80
References 1. Sobolova K,Hrabinova M,Hepnarova V,Kucera T,Kobrlova T,Benkova M,Janockova J,Dolezal R,Prchal L,Benek O,Mezeiova E,Jun D,Soukup O,Korabecny J. (2020) Discovery of novel berberine derivatives with balanced cholinesterase and prolyl oligopeptidase inhibition profile., 203 [PMID:32688201 ] [10.1016/j.ejmech.2020.112593 ]