N-((4'-(1-((5-cyclopropyl-1H-pyrazol-3-yl)amino)-1-oxopropan-2-yl)-[1,1'-biphenyl]-4-yl)methyl)acrylamide

ID: ALA4762563

PubChem CID: 155168084

Max Phase: Preclinical

Molecular Formula: C25H26N4O2

Molecular Weight: 414.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CC(=O)NCc1ccc(-c2ccc(C(C)C(=O)Nc3cc(C4CC4)[nH]n3)cc2)cc1

Standard InChI:  InChI=1S/C25H26N4O2/c1-3-24(30)26-15-17-4-6-19(7-5-17)20-10-8-18(9-11-20)16(2)25(31)27-23-14-22(28-29-23)21-12-13-21/h3-11,14,16,21H,1,12-13,15H2,2H3,(H,26,30)(H2,27,28,29,31)

Standard InChI Key:  ZIAQTARFHIBGJS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    6.4346  -11.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1426  -10.9227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8468  -11.3294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8468  -12.1488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1452  -12.5595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4346  -12.1541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7224  -12.5618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0143  -12.1541    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3063  -12.5618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5982  -12.1541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8860  -12.5618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3063  -13.3812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5590  -10.9217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5593  -10.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2649   -9.6972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9732  -10.1051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9755  -10.9187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2714  -11.3319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6813   -9.6974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6813   -8.8780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3935  -10.1051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3935  -10.9245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1016   -9.6974    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8096  -10.1051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5218   -9.6974    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1351  -10.2642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.8065  -10.9922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9885  -10.8984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2142  -11.7003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2142  -12.5219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9257  -12.1091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
  9 12  2  0
 13  3  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 13 18  1  0
 16 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 25 24  2  0
 25 26  1  0
 26 27  1  0
 28 27  2  0
 24 28  1  0
 29 27  1  0
 29 30  1  0
 30 31  1  0
 29 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4762563

    ---

Associated Targets(Human)

CDK12 Tchem Cyclin-dependent kinase 12 (438 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK13 Tchem Cyclin-dependent kinase 13 (570 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK7 Tchem Cyclin-dependent kinase 7 (1512 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.51Molecular Weight (Monoisotopic): 414.2056AlogP: 4.50#Rotatable Bonds: 8
Polar Surface Area: 86.88Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.26CX Basic pKa: 1.99CX LogP: 4.46CX LogD: 4.46
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: -0.92

References

1.  (2020)  Substituted 5-cyclopropyl-1h-pyrazol-3-yl-amine derivatives as selective cdk12/13 inhibitors, 
2.  (2020)  Substituted 5-cyclopropyl-1h-pyrazol-3-yl-amine derivatives as selective cdk12/13 inhibitors, 
3.  (2020)  Substituted 5-cyclopropyl-1h-pyrazol-3-yl-amine derivatives as selective cdk12/13 inhibitors, 

Source