The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-hydroxy-N-(4-methoxy-7-morpholinothiazolo[4,5-c]pyridin-2-yl)-4-methylpiperidine-1-carboxamide ID: ALA4762582
PubChem CID: 146652574
Max Phase: Preclinical
Molecular Formula: C18H25N5O4S
Molecular Weight: 407.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ncc(N2CCOCC2)c2sc(NC(=O)N3CCC(C)(O)CC3)nc12
Standard InChI: InChI=1S/C18H25N5O4S/c1-18(25)3-5-23(6-4-18)17(24)21-16-20-13-14(28-16)12(11-19-15(13)26-2)22-7-9-27-10-8-22/h11,25H,3-10H2,1-2H3,(H,20,21,24)
Standard InChI Key: WKIMWOZQJDQLQF-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
12.9766 -6.7506 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2645 -7.1672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9812 -7.5756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8663 -7.4961 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8652 -8.3230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5796 -8.7357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5779 -7.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2929 -7.4925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2977 -8.3185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0848 -8.5691 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.5665 -7.8980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0770 -7.2326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5828 -9.5581 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8674 -9.9699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8665 -10.7910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5794 -11.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2947 -10.7942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2973 -9.9670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5754 -6.2589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2882 -5.8445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3910 -7.8932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7991 -7.1766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6236 -7.1718 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3826 -6.4650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0347 -7.8871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8556 -7.8842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8524 -6.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0252 -6.4572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
13 14 1 0
13 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
6 13 1 0
7 19 1 0
19 20 1 0
11 21 1 0
21 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
23 28 1 0
25 26 1 0
26 2 1 0
2 27 1 0
27 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 407.50Molecular Weight (Monoisotopic): 407.1627AlogP: 1.92#Rotatable Bonds: 3Polar Surface Area: 100.05Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.74CX Basic pKa: ┄CX LogP: 0.86CX LogD: 0.70Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.80Np Likeness Score: -1.42