4-(3-(1-(3,4-Dichlorophenyl)-5-methyl-1H-pyrazol-3-yl)propyl)morpholine

ID: ALA4762627

PubChem CID: 58514002

Max Phase: Preclinical

Molecular Formula: C17H21Cl2N3O

Molecular Weight: 354.28

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(CCCN2CCOCC2)nn1-c1ccc(Cl)c(Cl)c1

Standard InChI:  InChI=1S/C17H21Cl2N3O/c1-13-11-14(3-2-6-21-7-9-23-10-8-21)20-22(13)15-4-5-16(18)17(19)12-15/h4-5,11-12H,2-3,6-10H2,1H3

Standard InChI Key:  ABPFXMWOQGUVCF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   17.0302  -16.7868    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.6744  -16.2794    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.3909  -15.5098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5714  -15.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3485  -16.3309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8452  -14.8306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6606  -14.8844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1150  -14.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0618  -17.6018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3689  -18.0370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8173  -18.7943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7825  -17.9799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1238  -19.2345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4021  -18.8526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7107  -19.2883    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   17.1560  -20.0511    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   15.5817  -16.6134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9304  -14.2590    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.2844  -14.9923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0961  -15.0478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5541  -14.3706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.1944  -13.6358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3766  -13.5782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  3  6  1  0
  6  7  1  0
  7  8  1  0
  9 10  2  0
 10 14  1  0
 13 11  1  0
 11 12  2  0
 12  9  1  0
  1  9  1  0
 13 14  2  0
 14 15  1  0
 13 16  1  0
  5 17  1  0
  8 18  1  0
 18 19  1  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
M  END

Associated Targets(Human)

SIGMAR1 Tclin Sigma opioid receptor (6358 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KCNH2 Tclin HERG (29587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 354.28Molecular Weight (Monoisotopic): 353.1062AlogP: 3.75#Rotatable Bonds: 5
Polar Surface Area: 30.29Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.06CX LogP: 3.80CX LogD: 3.63
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.82Np Likeness Score: -2.25

References

1. Díaz JL,García M,Torrens A,Caamaño AM,Enjo J,Sicre C,Lorente A,Port A,Montero A,Yeste S,Álvarez I,Martín M,Maldonado R,de laPuente B,Vidal-Torres A,Cendán CM,Vela JM,Almansa C.  (2020)  EST64454: a Highly Soluble σ Receptor Antagonist Clinical Candidate for Pain Management.,  63  (23): [PMID:33237785] [10.1021/acs.jmedchem.0c01575]

Source