Ethyl 2-(3-Cyanophenyl)-4-methyl-1-[(4-nitrobenzyl)oxy]-1H-imidazole-5-carboxylate

ID: ALA4762718

PubChem CID: 162660254

Max Phase: Preclinical

Molecular Formula: C21H18N4O5

Molecular Weight: 406.40

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1c(C)nc(-c2cccc(C#N)c2)n1OCc1ccc([N+](=O)[O-])cc1

Standard InChI:  InChI=1S/C21H18N4O5/c1-3-29-21(26)19-14(2)23-20(17-6-4-5-16(11-17)12-22)24(19)30-13-15-7-9-18(10-8-15)25(27)28/h4-11H,3,13H2,1-2H3

Standard InChI Key:  LHRXMXQZCWZXOD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   33.1856  -21.1479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1845  -21.9674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8925  -22.3764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6022  -21.9669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5994  -21.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8907  -20.7390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3033  -20.7347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0511  -21.0642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.5956  -20.4549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1843  -19.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3857  -19.9217    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.4086  -20.5372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5138  -19.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3262  -18.9123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.0309  -18.3416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.6557  -18.1645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4681  -18.0759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8953  -23.1896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8951  -24.0067    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.7763  -19.3772    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.0001  -19.6327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3907  -19.0882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5610  -18.2919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9525  -17.7477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1753  -18.0030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0101  -18.8077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6200  -19.3484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5646  -17.4582    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.7887  -17.7147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.7304  -16.6580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11  7  1  0
  5  7  1  0
  9 12  1  0
 10 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  1  0
 16 17  1  0
 18 19  3  0
  3 18  1  0
 11 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 28 29  2  0
 28 30  1  0
 25 28  1  0
M  CHG  2  28   1  30  -1
M  END

Alternative Forms

  1. Parent:

    ALA4762718

    ---

Associated Targets(non-human)

Plasma (649 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 406.40Molecular Weight (Monoisotopic): 406.1277AlogP: 3.44#Rotatable Bonds: 7
Polar Surface Area: 120.28Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.21CX LogP: 3.52CX LogD: 3.52
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.33Np Likeness Score: -1.60

References

1. Lei Y,Zhang B,Liu D,Zhao J,Dai X,Gao J,Mao Q,Feng Y,Zhao J,Lin F,Duan Y,Zhang Y,Bao Z,Yang Y,Mou Y,Wang S.  (2020)  Switching a Xanthine Oxidase Inhibitor to a Dual-Target Antagonist of P2Y and P2Y as an Oral Antiplatelet Agent with a Wider Therapeutic Window in Rats than Ticagrelor.,  63  (24): [PMID:33307675] [10.1021/acs.jmedchem.0c01524]

Source