Methyl ((3-(3-(2-(2-cyclopropyl-1H-imidazol-1-yl)acetyl)phenyl)-5-isobutylthiophen-2-yl)sulfonyl)carbamate

ID: ALA4762752

PubChem CID: 162660565

Max Phase: Preclinical

Molecular Formula: C24H27N3O5S2

Molecular Weight: 501.63

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)NS(=O)(=O)c1sc(CC(C)C)cc1-c1cccc(C(=O)Cn2ccnc2C2CC2)c1

Standard InChI:  InChI=1S/C24H27N3O5S2/c1-15(2)11-19-13-20(23(33-19)34(30,31)26-24(29)32-3)17-5-4-6-18(12-17)21(28)14-27-10-9-25-22(27)16-7-8-16/h4-6,9-10,12-13,15-16H,7-8,11,14H2,1-3H3,(H,26,29)

Standard InChI Key:  PWNGRYBTVXPJDI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   11.8156   -9.7132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4009   -9.9626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4802   -4.6658    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2187  -10.8669    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1872   -6.0877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0097   -6.9539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7795   -6.1621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6351  -10.7831    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5130   -5.4886    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5839   -9.9673    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.6977   -5.4524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1550  -10.1914    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.9884   -9.2574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7133   -7.5293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3418   -7.7022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0454   -8.2734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7152   -9.9615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3155  -12.4972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2197  -11.2842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1958   -6.8670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9492  -11.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1825   -5.4531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7461   -8.9328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9976  -12.0485    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5851  -10.7672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9648   -6.1697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5633   -8.9352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7970   -4.7242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4932   -9.7092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8204  -11.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1614   -4.2141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8597   -8.3640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4275   -6.3825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0627   -6.8930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 15 32  1  0
 28  9  1  0
 11  9  1  0
 16 14  1  0
 26  9  1  0
 14 20  2  0
 29 12  1  0
 21  8  1  0
 10 13  2  0
 11  5  1  0
 10  1  1  0
 23 29  2  0
 31 28  2  0
 27 16  1  0
 17 25  1  0
 21  4  2  0
 11  3  2  0
  1 27  2  0
 25 30  1  0
 27 23  1  0
  7 22  2  0
  2 10  2  0
  1 12  1  0
 29 17  1  0
 20  7  1  0
  3 31  1  0
 25 19  1  0
 20  6  1  0
 24 18  1  0
  7 26  1  0
 21 24  1  0
  6 15  2  0
  8 10  1  0
 16 32  2  0
 33  5  1  0
 34 33  1  0
  5 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4762752

    ---

Associated Targets(Human)

AGTR2 Tchem Angiotensin II type 2 (AT-2) receptor (2549 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 501.63Molecular Weight (Monoisotopic): 501.1392AlogP: 4.62#Rotatable Bonds: 9
Polar Surface Area: 107.36Molecular Species: ACIDHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.62CX Basic pKa: 6.99CX LogP: 3.25CX LogD: 3.78
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.43Np Likeness Score: -0.88

References

1. Wannberg J,Gising J,Lindman J,Salander J,Gutiérrez-de-Terán H,Ablahad H,Hamid S,Grönbladh A,Spizzo I,Gaspari TA,Widdop RE,Hallberg A,Backlund M,Leśniak A,Hallberg M,Larhed M.  (2021)  N-(Methyloxycarbonyl)thiophene sulfonamides as high affinity AT2 receptor ligands.,  29  [PMID:33309749] [10.1016/j.bmc.2020.115859]

Source