The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(Benzyloxy)-N-(2-hydroxyethyl)-2-oxo-2H-chromene-3-carboxamide ID: ALA4762756
PubChem CID: 162660569
Max Phase: Preclinical
Molecular Formula: C19H17NO5
Molecular Weight: 339.35
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCO)c1cc2ccc(OCc3ccccc3)cc2oc1=O
Standard InChI: InChI=1S/C19H17NO5/c21-9-8-20-18(22)16-10-14-6-7-15(11-17(14)25-19(16)23)24-12-13-4-2-1-3-5-13/h1-7,10-11,21H,8-9,12H2,(H,20,22)
Standard InChI Key: KMNIFMUQMZZKBK-UHFFFAOYSA-N
Molfile:
RDKit 2D
25 27 0 0 0 0 0 0 0 0999 V2000
34.7375 -2.2039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7363 -3.0234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4444 -3.4324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1540 -3.0230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1512 -2.2003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4426 -1.7950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8574 -1.7890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5666 -2.1950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8624 -3.4305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.5694 -3.0207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2782 -3.4276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.2728 -1.7838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2699 -0.9666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.9820 -2.1899 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.6882 -1.7787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3974 -2.1848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1037 -1.7736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.0283 -3.4315 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.3209 -3.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6129 -3.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9062 -3.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1987 -3.4264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1976 -4.2444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9100 -4.6534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6146 -4.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
4 9 1 0
8 10 1 0
9 10 1 0
10 11 2 0
8 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
2 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 339.35Molecular Weight (Monoisotopic): 339.1107AlogP: 2.09#Rotatable Bonds: 6Polar Surface Area: 88.77Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 1.66CX LogD: 1.66Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.67Np Likeness Score: -0.61
References 1. Ji H,Tan Y,Gan N,Zhang J,Li S,Zheng X,Wang Z,Yi W. (2021) Synthesis and anticancer activity of new coumarin-3-carboxylic acid derivatives as potential lactatetransportinhibitors., 29 [PMID:33221062 ] [10.1016/j.bmc.2020.115870 ]