methyl 2-(3-(1,2,3,5,6,7-hexahydros-indacen-4-yl)ureido)-4-phenylbutanoate

ID: ALA4762837

PubChem CID: 162659475

Max Phase: Preclinical

Molecular Formula: C24H28N2O3

Molecular Weight: 392.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)C(CCc1ccccc1)NC(=O)Nc1c2c(cc3c1CCC3)CCC2

Standard InChI:  InChI=1S/C24H28N2O3/c1-29-23(27)21(14-13-16-7-3-2-4-8-16)25-24(28)26-22-19-11-5-9-17(19)15-18-10-6-12-20(18)22/h2-4,7-8,15,21H,5-6,9-14H2,1H3,(H2,25,26,28)

Standard InChI Key:  IXBBGBOYEKTLRF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   38.8663  -27.8811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2963  -28.7079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5799  -29.1212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8654  -28.7115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2549  -29.2643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5920  -30.0158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4109  -29.9273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0114  -29.1190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.7251  -28.7052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4404  -29.1163    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.7235  -27.8803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.5782  -27.4635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2929  -27.8766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9066  -27.3245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5711  -26.5702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7502  -26.6562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1540  -28.7025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8692  -29.1136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.5828  -28.6998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.8707  -29.9385    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.2980  -29.1108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1523  -27.8776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8660  -27.4637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8644  -26.6387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.5817  -26.2275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.5804  -25.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8647  -24.9962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1487  -25.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1534  -26.2325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  4  2  0
  3  2  2  0
  2 13  1  0
 12  1  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  3  1  0
  2  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 12  1  0
 10 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 17 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4762837

    ---

Associated Targets(Human)

NLRP3 Tchem NACHT, LRR and PYD domains-containing protein 3 (908 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 392.50Molecular Weight (Monoisotopic): 392.2100AlogP: 3.96#Rotatable Bonds: 6
Polar Surface Area: 67.43Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.67CX Basic pKa: CX LogP: 5.41CX LogD: 5.41
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.73Np Likeness Score: -0.36

References

1. Harrison D,Boutard N,Brzozka K,Bugaj M,Chmielewski S,Cierpich A,Doedens JR,Fabritius CRY,Gabel CA,Galezowski M,Kowalczyk P,Levenets O,Mroczkowska M,Palica K,Porter RA,Schultz D,Sowinska M,Topolnicki G,Urbanski P,Woyciechowski J,Watt AP.  (2020)  Discovery of a series of ester-substituted NLRP3 inflammasome inhibitors.,  30  (23): [PMID:32956781] [10.1016/j.bmcl.2020.127560]

Source