3,5-dichloro-N-[3-chloro-4-(3-hydroxyphenoxy)phenyl]-2-hydroxy-benzamide

ID: ALA4762871

PubChem CID: 162660159

Max Phase: Preclinical

Molecular Formula: C19H12Cl3NO4

Molecular Weight: 424.67

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(Oc2cccc(O)c2)c(Cl)c1)c1cc(Cl)cc(Cl)c1O

Standard InChI:  InChI=1S/C19H12Cl3NO4/c20-10-6-14(18(25)16(22)7-10)19(26)23-11-4-5-17(15(21)8-11)27-13-3-1-2-12(24)9-13/h1-9,24-25H,(H,23,26)

Standard InChI Key:  IGKPTXCWCUVUSI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   26.7205  -19.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7212  -20.5023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4339  -20.9134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1422  -20.4985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1374  -19.6722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4283  -19.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8556  -20.9085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.5658  -20.4930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2764  -20.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9862  -20.4926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9835  -19.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2651  -19.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5582  -19.6778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2768  -21.7287    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   31.6931  -19.2581    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.4071  -19.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1168  -19.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4114  -20.4843    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.8251  -19.6578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5343  -19.2462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5304  -18.4240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8115  -18.0152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1094  -18.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3938  -18.0270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.8044  -17.1939    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   35.2480  -19.6515    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   26.0138  -20.9113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  9 14  1  0
 11 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 17  1  0
 23 24  1  0
 22 25  1  0
 20 26  1  0
  2 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4762871

    ---

Associated Targets(Human)

STK39 Tchem STE20/SPS1-related proline-alanine-rich protein kinase (342 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 424.67Molecular Weight (Monoisotopic): 422.9832AlogP: 6.10#Rotatable Bonds: 4
Polar Surface Area: 78.79Molecular Species: ACIDHBA: 4HBD: 3
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 5.95CX Basic pKa: CX LogP: 5.77CX LogD: 4.40
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.47Np Likeness Score: -0.98

References

1. Fujii S,Kikuchi E,Watanabe Y,Suzuyama H,Ishigami-Yuasa M,Mori T,Isobe K,Uchida S,Kagechika H.  (2020)  Structural development of N-(4-phenoxyphenyl)benzamide derivatives as novel SPAK inhibitors blocking WNK kinase signaling.,  30  (17): [PMID:32738993] [10.1016/j.bmcl.2020.127408]

Source