Ethyl 2-(4-(1-(4-methoxyphenyl)-4-oxo-4,5-dihydro-1H-pyrazolo[3,4-d]pyrimidin-6-yl)phenoxy)propanoate

ID: ALA4763010

PubChem CID: 162660371

Max Phase: Preclinical

Molecular Formula: C23H22N4O5

Molecular Weight: 434.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)C(C)Oc1ccc(-c2nc3c(cnn3-c3ccc(OC)cc3)c(=O)[nH]2)cc1

Standard InChI:  InChI=1S/C23H22N4O5/c1-4-31-23(29)14(2)32-18-9-5-15(6-10-18)20-25-21-19(22(28)26-20)13-24-27(21)16-7-11-17(30-3)12-8-16/h5-14H,4H2,1-3H3,(H,25,26,28)

Standard InChI Key:  RPYAITNCSDCLBW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    5.7878  -16.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7867  -16.8934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5017  -17.3082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2184  -16.8929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2156  -16.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5000  -15.6559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9257  -15.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6422  -16.0604    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6311  -14.4111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9213  -14.8298    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3523  -14.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3552  -15.6460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1395  -15.8964    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6188  -15.2277    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1347  -14.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3930  -16.6771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8403  -17.2929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1002  -18.0759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9083  -18.2443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4560  -17.6235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1974  -16.8429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6251  -13.5865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0757  -17.3073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3613  -16.8923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6463  -17.3061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9319  -16.8912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2168  -17.3050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6456  -18.1308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1657  -19.0274    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6154  -19.6440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3620  -16.0718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5024  -16.8900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8 12  1  0
 11  9  1  0
  9 10  1  0
 10  7  1  0
  5  7  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 11  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 13 16  1  0
  9 22  2  0
  2 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 25 28  2  0
 19 29  1  0
 29 30  1  0
 24 31  1  0
 27 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4763010

    ---

Associated Targets(non-human)

L6 (7924 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Slc2a4 Solute carrier family 2, facilitated glucose transporter member 4 (143 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 434.45Molecular Weight (Monoisotopic): 434.1590AlogP: 3.11#Rotatable Bonds: 7
Polar Surface Area: 108.33Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.24CX Basic pKa: CX LogP: 3.04CX LogD: 3.03
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.45Np Likeness Score: -1.50

References

1. Gupta S,Rai AK,Pandey S,Singh LR,Kant R,Tamrakar AK,Sashidhara KV.  (2021)  Microwave-assisted efficient synthesis of pyrazole-fibrate derivatives as stimulators of glucose uptake in skeletal muscle cells.,  34  [PMID:33359606] [10.1016/j.bmcl.2020.127760]

Source