4-(2-Aminoimidazolino)-4'-[3-(furanyl-2-methyl)guanidino]diphenylmethane dihydrochloride

ID: ALA4763113

PubChem CID: 162659581

Max Phase: Preclinical

Molecular Formula: C22H26Cl2N6O

Molecular Weight: 388.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cl.Cl.N=C(NCc1ccco1)Nc1ccc(Cc2ccc(NC3=NCCN3)cc2)cc1

Standard InChI:  InChI=1S/C22H24N6O.2ClH/c23-21(26-15-20-2-1-13-29-20)27-18-7-3-16(4-8-18)14-17-5-9-19(10-6-17)28-22-24-11-12-25-22;;/h1-10,13H,11-12,14-15H2,(H3,23,26,27)(H2,24,25,28);2*1H

Standard InChI Key:  RRPUUTWYKZWDED-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 32  0  0  0  0  0  0  0  0999 V2000
   44.6089  -18.1205    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   34.3851  -15.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3839  -15.9226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0987  -16.3355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8151  -15.9222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8122  -15.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0969  -14.6826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5251  -14.6766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2411  -15.0864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2409  -15.9089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9560  -16.3187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6699  -15.9035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6641  -15.0742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9484  -14.6682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3864  -16.3123    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.0988  -15.8962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6691  -16.3346    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.9550  -15.9215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0946  -15.0712    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.8153  -16.3050    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.8683  -15.1032    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.0615  -14.9310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6484  -15.6452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2000  -16.2586    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.5276  -15.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2442  -16.2977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3368  -17.1132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.1446  -17.2807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5535  -16.5640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9982  -15.9538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.9018  -14.3196    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  6  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 12 15  1  0
 15 16  1  0
  3 17  1  0
 17 18  1  0
 16 19  2  0
 16 20  1  0
 18 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 18  1  0
 20 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 26  2  0
M  END

Associated Targets(Human)

ADRA2A Tclin Adrenergic receptor alpha-2 (812 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 388.48Molecular Weight (Monoisotopic): 388.2012AlogP: 3.38#Rotatable Bonds: 6
Polar Surface Area: 97.47Molecular Species: BASEHBA: 5HBD: 5
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.64CX LogP: 3.41CX LogD: 1.55
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.33Np Likeness Score: -0.71

References

1. McMullan M,Kelly B,Mihigo HB,Keogh AP,Rodriguez F,Brocos-Mosquera I,García-Bea A,Miranda-Azpiazu P,Callado LF,Rozas I.  (2021)  Di-aryl guanidinium derivatives: Towards improved α2-Adrenergic affinity and antagonist activity.,  209  [PMID:33139112] [10.1016/j.ejmech.2020.112947]

Source